Difference between revisions of "THR-tRNAs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1081 CPD-1081] == * smiles: ** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CC...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THR-tRNAs THR-tRNAs] == * common name: ** a tRNAthr * Synonym(s): ** TRNA(THR) == Reaction(s)...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1081 CPD-1081] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THR-tRNAs THR-tRNAs] ==
* smiles:
+
** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
+
* inchi key:
+
** InChIKey=PESKGJQREUXSRR-UXIWKSIVSA-N
+
 
* common name:
 
* common name:
** 5α-cholestan-3-one
+
** a tRNAthr
* molecular weight:
+
** 386.66   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** TRNA(THR)
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[THREONINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[CHOLESTENONE-5-ALPHA-REDUCTASE-RXN]]
 
 
== External links  ==
 
== External links  ==
* CAS : 566-88-1
+
{{#set: common name=a tRNAthr}}
* PUBCHEM:
+
{{#set: common name=TRNA(THR)}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=92128 92128]
+
{{#set: consumed by=THREONINE--TRNA-LIGASE-RXN}}
* HMDB : HMDB00871
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C03238 C03238]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.83174.html 83174]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17762 17762]
+
{{#set: smiles=CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: inchi key=InChIKey=PESKGJQREUXSRR-UXIWKSIVSA-N}}
+
{{#set: common name=5α-cholestan-3-one}}
+
{{#set: molecular weight=386.66    }}
+
{{#set: consumed or produced by=CHOLESTENONE-5-ALPHA-REDUCTASE-RXN}}
+

Latest revision as of 19:08, 21 March 2018

Metabolite THR-tRNAs

  • common name:
    • a tRNAthr
  • Synonym(s):
    • TRNA(THR)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links