Difference between revisions of "RXN-4241"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GULONATE L-GULONATE] == * smiles: ** C(O)C(O)C(O)C(O)C(O)C(=O)[O-] * inchi key: ** InChIKey=R...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-4241 RXN-4241] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GULONATE L-GULONATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-4241 RXN-4241] ==
−
* smiles:
+
* direction:
−
** C(O)C(O)C(O)C(O)C(O)C(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=RGHNJXZEOKUKBD-QTBDOELSSA-M
+
** [http://enzyme.expasy.org/EC/1.14.13 EC-1.14.13]
−
* common name:
+
−
** L-gulonate
+
−
* molecular weight:
+
−
** 195.149   
+
 
* Synonym(s):
 
* Synonym(s):
−
** gulonate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-8783]]
+
** 1 [[CPD-720]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[NADPH]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[CPD-17420]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 6-deoxotyphasterol[c] '''+''' 1 H+[c] '''+''' 1 oxygen[c] '''+''' 1 NADPH[c] '''=>''' 1 NADP+[c] '''+''' 1 H2O[c] '''+''' 1 6-hydroxytyphasterol[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_8263]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_3577]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-699]], brassinosteroid biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-699 PWY-699]
 +
** '''11''' reactions found over '''25''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6857680 6857680]
+
** [http://www.genome.jp/dbget-bin/www_bget?R07458 R07458]
−
* CHEMSPIDER:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.chemspider.com/Chemical-Structure.5257015.html 5257015]
+
{{#set: ec number=EC-1.14.13}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_8263|Tiso_gene_3577}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=13115 13115]
+
{{#set: in pathway=PWY-699}}
−
* METABOLIGHTS : MTBLC13115
+
{{#set: reconstruction category=orthology}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00800 C00800]
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: smiles=C(O)C(O)C(O)C(O)C(O)C(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=RGHNJXZEOKUKBD-QTBDOELSSA-M}}
+
−
{{#set: common name=L-gulonate}}
+
−
{{#set: molecular weight=195.149    }}
+
−
{{#set: common name=gulonate}}
+
−
{{#set: produced by=RXN-8783}}
+

Latest revision as of 19:08, 21 March 2018

Reaction RXN-4241

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 6-deoxotyphasterol[c] + 1 H+[c] + 1 oxygen[c] + 1 NADPH[c] => 1 NADP+[c] + 1 H2O[c] + 1 6-hydroxytyphasterol[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-699, brassinosteroid biosynthesis I: PWY-699
    • 11 reactions found over 25 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-4241&oldid=39722"