Difference between revisions of "Tiso gene 7634"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12482 CPD-12482] == * smiles: ** CN1(C(=O)NC2(=C1C(=O)NC(=O)N(C)2)) * common name: ** 3,7-d...") |
(Created page with "Category:Gene == Gene Tiso_gene_7634 == * Synonym(s): == Reactions associated == * Reaction: PROTEIN-KINASE-RXN ** Source: orthology-esiliculosus == Pathways asso...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_7634 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[PROTEIN-KINASE-RXN]] | |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
− | == | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: reaction associated=PROTEIN-KINASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Latest revision as of 19:08, 21 March 2018
Gene Tiso_gene_7634
- Synonym(s):
Reactions associated
- Reaction: PROTEIN-KINASE-RXN
- Source: orthology-esiliculosus