Difference between revisions of "RXN-13926"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1081 CPD-1081] == * smiles: ** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13926 RXN-13926] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/1.1...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1081 CPD-1081] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13926 RXN-13926] ==
* smiles:
+
* direction:
** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
+
** REVERSIBLE
* inchi key:
+
* ec number:
** InChIKey=PESKGJQREUXSRR-UXIWKSIVSA-N
+
** [http://enzyme.expasy.org/EC/1.1.1.170 EC-1.1.1.170]
* common name:
+
** 5α-cholestan-3-one
+
* molecular weight:
+
** 386.66   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
== Reaction(s) of unknown directionality ==
+
** 1 [[3beta-hydroxy-4alpha-carboxy-sterols]][c] '''+''' 1 [[NAD-P-OR-NOP]][c] '''<=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[3-Oxosteroids]][c] '''+''' 1 [[NADH-P-OR-NOP]][c]
* [[CHOLESTENONE-5-ALPHA-REDUCTASE-RXN]]
+
* With common name(s):
 +
** 1 a 3&beta;-hydroxy-4&alpha;-carboxysteroid[c] '''+''' 1 NAD(P)+[c] '''<=>''' 1 CO2[c] '''+''' 1 a 3-oxosteroid[c] '''+''' 1 NAD(P)H[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_897]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* CAS : 566-88-1
+
{{#set: direction=REVERSIBLE}}
* PUBCHEM:
+
{{#set: ec number=EC-1.1.1.170}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=92128 92128]
+
{{#set: gene associated=Tiso_gene_897}}
* HMDB : HMDB00871
+
{{#set: in pathway=}}
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
** [http://www.genome.jp/dbget-bin/www_bget?C03238 C03238]
+
{{#set: reconstruction source=orthology-esiliculosus}}
* CHEMSPIDER:
+
{{#set: reconstruction tool=pantograph}}
** [http://www.chemspider.com/Chemical-Structure.83174.html 83174]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17762 17762]
+
{{#set: smiles=CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: inchi key=InChIKey=PESKGJQREUXSRR-UXIWKSIVSA-N}}
+
{{#set: common name=5&alpha;-cholestan-3-one}}
+
{{#set: molecular weight=386.66    }}
+
{{#set: reversible reaction associated=CHOLESTENONE-5-ALPHA-REDUCTASE-RXN}}
+

Latest revision as of 20:08, 21 March 2018

Reaction RXN-13926

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links