Difference between revisions of "L-GULONATE"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_284 == * left end position: ** 22290 * transcription direction: ** POSITIVE * right end position: ** 25515 * centisome position: ** 61.0768...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GULONATE L-GULONATE] == * smiles: ** C(O)C(O)C(O)C(O)C(O)C(=O)[O-] * common name: ** L-gulona...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GULONATE L-GULONATE] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(O)C(O)C(O)C(O)C(O)C(=O)[O-] |
| − | * | + | * common name: |
| − | ** | + | ** L-gulonate |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=RGHNJXZEOKUKBD-QTBDOELSSA-M |
| − | * | + | * molecular weight: |
| − | ** | + | ** 195.149 |
* Synonym(s): | * Synonym(s): | ||
| + | ** gulonate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-8783]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | * [[RXN- | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6857680 6857680] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.5257015.html 5257015] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=13115 13115] |
| + | * METABOLIGHTS : MTBLC13115 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00800 C00800] | ||
| + | {{#set: smiles=C(O)C(O)C(O)C(O)C(O)C(=O)[O-]}} | ||
| + | {{#set: common name=L-gulonate}} | ||
| + | {{#set: inchi key=InChIKey=RGHNJXZEOKUKBD-QTBDOELSSA-M}} | ||
| + | {{#set: molecular weight=195.149 }} | ||
| + | {{#set: common name=gulonate}} | ||
| + | {{#set: produced by=RXN-8783}} | ||
Latest revision as of 19:08, 21 March 2018
Contents
Metabolite L-GULONATE
- smiles:
- C(O)C(O)C(O)C(O)C(O)C(=O)[O-]
- common name:
- L-gulonate
- inchi key:
- InChIKey=RGHNJXZEOKUKBD-QTBDOELSSA-M
- molecular weight:
- 195.149
- Synonym(s):
- gulonate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C(O)C(O)C(O)C(O)C(=O)[O-" cannot be used as a page name in this wiki.
