Difference between revisions of "Tiso gene 10743"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-27 CPD66-27] == * smiles: ** CC(=O)C4(O)(CCC2(C(C)(CCC1(C3(C)(C(=CCC12)CC(=O)CC3)))4)) *...")
(Created page with "Category:Gene == Gene Tiso_gene_10743 == * right end position: ** 7952 * transcription direction: ** POSITIVE * left end position: ** 5264 * centisome position: ** 63.2008...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-27 CPD66-27] ==
+
== Gene Tiso_gene_10743 ==
* smiles:
+
* right end position:
** CC(=O)C4(O)(CCC2(C(C)(CCC1(C3(C)(C(=CCC12)CC(=O)CC3)))4))
+
** 7952
* inchi key:
+
* transcription direction:
** InChIKey=RCFJDVCRANOZEL-UHFFFAOYSA-N
+
** POSITIVE
* common name:
+
* left end position:
** pregn-5-ene-3,20-dione-17-ol
+
** 5264
* molecular weight:
+
* centisome position:
** 330.466    
+
** 63.200867    
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[3.1.26.4-RXN]]
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-in-silico_annotation]]
* [[RXN66-350]]
+
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=7952}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14562950 14562950]
+
{{#set: transcription direction=POSITIVE}}
{{#set: smiles=CC(=O)C4(O)(CCC2(C(C)(CCC1(C3(C)(C(=CCC12)CC(=O)CC3)))4))}}
+
{{#set: left end position=5264}}
{{#set: inchi key=InChIKey=RCFJDVCRANOZEL-UHFFFAOYSA-N}}
+
{{#set: centisome position=63.200867   }}
{{#set: common name=pregn-5-ene-3,20-dione-17-ol}}
+
{{#set: reaction associated=3.1.26.4-RXN}}
{{#set: molecular weight=330.466   }}
+
{{#set: consumed or produced by=RXN66-350}}
+

Latest revision as of 19:08, 21 March 2018

Gene Tiso_gene_10743

  • right end position:
    • 7952
  • transcription direction:
    • POSITIVE
  • left end position:
    • 5264
  • centisome position:
    • 63.200867
  • Synonym(s):

Reactions associated

Pathways associated

External links