Difference between revisions of "RXN-16332"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1081 CPD-1081] == * smiles: ** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16332 RXN-16332] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1081 CPD-1081] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16332 RXN-16332] ==
* smiles:
+
* direction:
** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
+
** LEFT-TO-RIGHT
* common name:
+
* ec number:
** 5α-cholestan-3-one
+
** [http://enzyme.expasy.org/EC/1.14.19.17 EC-1.14.19.17]
* inchi key:
+
** InChIKey=PESKGJQREUXSRR-UXIWKSIVSA-N
+
* molecular weight:
+
** 386.66   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
== Reaction(s) of unknown directionality ==
+
** 2 [[PROTON]][c] '''+''' 1 [[CPD3DJ-82]][c] '''+''' 2 [[FERROCYTOCHROME-B5]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[N-Acylsphingosine]][c] '''+''' 2 [[FERRICYTOCHROME-B5]][c] '''+''' 2 [[WATER]][c]
* [[CHOLESTENONE-5-ALPHA-REDUCTASE-RXN]]
+
* With common name(s):
 +
** 2 H+[c] '''+''' 1 a dihydroceramide[c] '''+''' 2 a ferrocytochrome b5[c] '''+''' 1 oxygen[c] '''=>''' 1 a sphingosine ceramide[c] '''+''' 2 a ferricytochrome b5[c] '''+''' 2 H2O[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY3DJ-12]], ceramide de novo biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY3DJ-12 PWY3DJ-12]
 +
** '''4''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* CAS : 566-88-1
+
{{#set: direction=LEFT-TO-RIGHT}}
* PUBCHEM:
+
{{#set: ec number=EC-1.14.19.17}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=92128 92128]
+
{{#set: in pathway=PWY3DJ-12}}
* HMDB : HMDB00871
+
{{#set: reconstruction category=annotation}}
* LIGAND-CPD:
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
** [http://www.genome.jp/dbget-bin/www_bget?C03238 C03238]
+
{{#set: reconstruction tool=pathwaytools}}
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.83174.html 83174]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17762 17762]
+
{{#set: smiles=CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: common name=5α-cholestan-3-one}}
+
{{#set: inchi key=InChIKey=PESKGJQREUXSRR-UXIWKSIVSA-N}}
+
{{#set: molecular weight=386.66    }}
+
{{#set: reversible reaction associated=CHOLESTENONE-5-ALPHA-REDUCTASE-RXN}}
+

Latest revision as of 19:08, 21 March 2018

Reaction RXN-16332

Reaction Formula

Genes associated with this reaction

Pathways

  • PWY3DJ-12, ceramide de novo biosynthesis: PWY3DJ-12
    • 4 reactions found over 4 reactions in the full pathway

Reconstruction information

External links