Difference between revisions of "CPD-1081"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-OXOPALMITOYL-COA 3-OXOPALMITOYL-COA] == * smiles: ** CCCCCCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1081 CPD-1081] == * smiles: ** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CC...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1081 CPD-1081] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34)))) |
* common name: | * common name: | ||
− | ** | + | ** 5α-cholestan-3-one |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=PESKGJQREUXSRR-UXIWKSIVSA-N |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 386.66 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[CHOLESTENONE-5-ALPHA-REDUCTASE-RXN]] |
== External links == | == External links == | ||
− | * | + | * CAS : 566-88-1 |
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=92128 92128] |
− | * HMDB : | + | * HMDB : HMDB00871 |
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03238 C03238] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.83174.html 83174] | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17762 17762] |
− | + | {{#set: smiles=CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}} | |
− | {{#set: smiles= | + | {{#set: common name=5α-cholestan-3-one}} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=PESKGJQREUXSRR-UXIWKSIVSA-N}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: molecular weight=386.66 }} |
− | {{#set: molecular weight= | + | {{#set: reversible reaction associated=CHOLESTENONE-5-ALPHA-REDUCTASE-RXN}} |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Latest revision as of 19:08, 21 March 2018
Contents
Metabolite CPD-1081
- smiles:
- CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
- common name:
- 5α-cholestan-3-one
- inchi key:
- InChIKey=PESKGJQREUXSRR-UXIWKSIVSA-N
- molecular weight:
- 386.66
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.