Difference between revisions of "Tiso gene 6151"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOPAMINE DOPAMINE] == * smiles: ** C(CC1(C=C(C(=CC=1)O)O))[N+] * inchi key: ** InChIKey=VYFYYTL...") |
(Created page with "Category:Gene == Gene Tiso_gene_6151 == * right end position: ** 5949 * transcription direction: ** POSITIVE * left end position: ** 2888 * centisome position: ** 15.85158...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_6151 == |
− | * | + | * right end position: |
− | ** | + | ** 5949 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 2888 |
− | * | + | * centisome position: |
− | ** | + | ** 15.851584 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[2.1.1.127-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | + | *** Assignment: ec-number | |
− | == | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: right end position=5949}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=2888}} | |
− | + | {{#set: centisome position=15.851584 }} | |
− | + | {{#set: reaction associated=2.1.1.127-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:08, 21 March 2018
Gene Tiso_gene_6151
- right end position:
- 5949
- transcription direction:
- POSITIVE
- left end position:
- 2888
- centisome position:
- 15.851584
- Synonym(s):
Reactions associated
- Reaction: 2.1.1.127-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation