Difference between revisions of "L-methionyl-L-valyl-Protein"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-700 CPD-700] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-methionyl-L-valyl-Protein L-methionyl-L-valyl-Protein] == * common name: ** an N-terminal-L-m...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-700 CPD-700] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-methionyl-L-valyl-Protein L-methionyl-L-valyl-Protein] ==
* smiles:
+
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
* inchi key:
+
** InChIKey=ZEPNVCGPJXYABB-LOIOQLKMSA-N
+
 
* common name:
 
* common name:
** ergosta-5,7,24(28)-trien-3β-ol
+
** an N-terminal-L-methionyl-L-valyl-[protein]
* molecular weight:
+
** 396.655   
+
 
* Synonym(s):
 
* Synonym(s):
** 5,7,24(28)-ergostatrienol
 
** 5-dehydro episterol
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-707]]
+
* [[RXN-17878]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN3O-218]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: common name=an N-terminal-L-methionyl-L-valyl-[protein]}}
** [http://www.genome.jp/dbget-bin/www_bget?C15780 C15780]
+
{{#set: consumed by=RXN-17878}}
* HMDB : HMDB06848
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=52972 52972]
+
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10894570 10894570]
+
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: inchi key=InChIKey=ZEPNVCGPJXYABB-LOIOQLKMSA-N}}
+
{{#set: common name=ergosta-5,7,24(28)-trien-3β-ol}}
+
{{#set: molecular weight=396.655    }}
+
{{#set: common name=5,7,24(28)-ergostatrienol|5-dehydro episterol}}
+
{{#set: consumed by=RXN-707}}
+
{{#set: produced by=RXN3O-218}}
+

Latest revision as of 19:08, 21 March 2018

Metabolite L-methionyl-L-valyl-Protein

  • common name:
    • an N-terminal-L-methionyl-L-valyl-[protein]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an N-terminal-L-methionyl-L-valyl-[protein" cannot be used as a page name in this wiki.