Difference between revisions of "Tiso gene 4521"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19160 CPD-19160] == * smiles: ** CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...")
(Created page with "Category:Gene == Gene Tiso_gene_4521 == * Synonym(s): == Reactions associated == * Reaction: IGPSYN-RXN ** Source: orthology-esiliculosus ** Source: orthology-c...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19160 CPD-19160] ==
+
== Gene Tiso_gene_4521 ==
* smiles:
+
** CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=OUROWZUTGFHRJE-SAIINBSPSA-J
+
* common name:
+
** 3-oxo-(11Z)-octadecenoyl-CoA
+
* molecular weight:
+
** 1041.936   
+
 
* Synonym(s):
 
* Synonym(s):
** 3-oxo-18:1-Δ11-CoA
 
** 3-oxo-11-cis-octadecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-17787]]
+
* Reaction: [[IGPSYN-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-esiliculosus]]
* [[RXN-17786]]
+
** Source: [[orthology-creinhardtii]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[TRPSYN-PWY]]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction associated=IGPSYN-RXN}}
{{#set: inchi key=InChIKey=OUROWZUTGFHRJE-SAIINBSPSA-J}}
+
{{#set: pathway associated=TRPSYN-PWY}}
{{#set: common name=3-oxo-(11Z)-octadecenoyl-CoA}}
+
{{#set: molecular weight=1041.936    }}
+
{{#set: common name=3-oxo-18:1-Δ11-CoA|3-oxo-11-cis-octadecenoyl-CoA}}
+
{{#set: consumed by=RXN-17787}}
+
{{#set: produced by=RXN-17786}}
+

Latest revision as of 19:09, 21 March 2018

Gene Tiso_gene_4521

  • Synonym(s):

Reactions associated

Pathways associated

External links