Difference between revisions of "PWY-7720"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-XYLULOSE D-XYLULOSE] == * smiles: ** C(O)C(O)C(O)C(=O)CO * inchi key: ** InChIKey=ZAQJHHRNXZU...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7720 PWY-7720] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-XYLULOSE D-XYLULOSE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7720 PWY-7720] ==
* smiles:
+
* taxonomic range:
** C(O)C(O)C(O)C(=O)CO
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
* inchi key:
+
** InChIKey=ZAQJHHRNXZUBTE-WUJLRWPWSA-N
+
 
* common name:
 
* common name:
** D-xylulose
+
** ophiobolin F biosynthesis
* molecular weight:
+
** 150.131   
+
 
* Synonym(s):
 
* Synonym(s):
** xylulose
 
** D-threo-pentulose
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[XYLULOKIN-RXN]]
+
'''1''' reactions found over '''3''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[FARNESYLTRANSTRANSFERASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[Tiso_gene_7305]]
 +
*** [[Tiso_gene_16284]]
 +
** 6 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-15427 RXN-15427]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8813 RXN-8813]
 
== External links  ==
 
== External links  ==
* CAS : 551-84-8
+
{{#set: taxonomic range=TAX-4751}}
* METABOLIGHTS : MTBLC17140
+
{{#set: common name=ophiobolin F biosynthesis}}
* DRUGBANK : DB03947
+
{{#set: reaction found=1}}
* PUBCHEM:
+
{{#set: total reaction=3}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5289590 5289590]
+
{{#set: completion rate=33.0}}
* HMDB : HMDB01644
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00310 C00310]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.4451524.html 4451524]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17140 17140]
+
* BIGG : xylu__D
+
{{#set: smiles=C(O)C(O)C(O)C(=O)CO}}
+
{{#set: inchi key=InChIKey=ZAQJHHRNXZUBTE-WUJLRWPWSA-N}}
+
{{#set: common name=D-xylulose}}
+
{{#set: molecular weight=150.131    }}
+
{{#set: common name=xylulose|D-threo-pentulose}}
+
{{#set: consumed by=XYLULOKIN-RXN}}
+

Latest revision as of 20:09, 21 March 2018

Pathway PWY-7720

  • taxonomic range:
  • common name:
    • ophiobolin F biosynthesis
  • Synonym(s):

Reaction(s) found

1 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links