Difference between revisions of "Tiso gene 1398"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOPAMINE DOPAMINE] == * smiles: ** C(CC1(C=C(C(=CC=1)O)O))[N+] * inchi key: ** InChIKey=VYFYYTL...") |
(Created page with "Category:Gene == Gene Tiso_gene_1398 == * right end position: ** 21490 * transcription direction: ** POSITIVE * left end position: ** 16012 * centisome position: ** 67.046...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_1398 == |
− | * | + | * right end position: |
− | ** | + | ** 21490 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 16012 |
− | * | + | * centisome position: |
− | ** | + | ** 67.04631 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[3.2.1.23-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | + | *** Assignment: ec-number | |
− | == | + | ** Source: [[orthology-esiliculosus]] |
+ | * Reaction: [[BETAGALACTOSID-RXN]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[KETOLACTOSE-RXN]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-12398]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-12399]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-12400]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6807]] | ||
+ | * [[BGALACT-PWY]] | ||
+ | * [[LACTOSEUTIL-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=21490}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=16012}} | |
− | + | {{#set: centisome position=67.04631 }} | |
− | + | {{#set: reaction associated=3.2.1.23-RXN|BETAGALACTOSID-RXN|KETOLACTOSE-RXN|RXN-12398|RXN-12399|RXN-12400}} | |
− | + | {{#set: pathway associated=PWY-6807|BGALACT-PWY|LACTOSEUTIL-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:09, 21 March 2018
Gene Tiso_gene_1398
- right end position:
- 21490
- transcription direction:
- POSITIVE
- left end position:
- 16012
- centisome position:
- 67.04631
- Synonym(s):
Reactions associated
- Reaction: 3.2.1.23-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Reaction: BETAGALACTOSID-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Reaction: KETOLACTOSE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Reaction: RXN-12398
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Reaction: RXN-12399
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Reaction: RXN-12400
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation