Difference between revisions of "DIACYLGLYKIN-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SPERMIDINE SPERMIDINE] == * smiles: ** C([N+])CC[N+]CCCC[N+] * common name: ** spermidine * inc...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DIACYLGLYKIN-RXN DIACYLGLYKIN-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** diacylglycero...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SPERMIDINE SPERMIDINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DIACYLGLYKIN-RXN DIACYLGLYKIN-RXN] ==
−
* smiles:
+
* direction:
−
** C([N+])CC[N+]CCCC[N+]
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** spermidine
+
** diacylglycerol_kinase_catalytic_region
−
* inchi key:
+
** diacylglycerol_kinase
−
** InChIKey=ATHGHQPFGPMSJY-UHFFFAOYSA-Q
+
** sphingosine_kinase_1
−
* molecular weight:
+
* ec number:
−
** 148.271   
+
** [http://enzyme.expasy.org/EC/2.7.1.107 EC-2.7.1.107]
 
* Synonym(s):
 
* Synonym(s):
−
** N-(3-aminopropyl)butane-1,4-diamine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[SPERMINE-SYNTHASE-RXN]]
+
* With identifiers:
−
* [[SPMDtmi]]
+
** 1 [[DIACYLGLYCEROL]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[L-PHOSPHATIDATE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ADP]][c]
−
* [[RXN-13414]]
+
* With common name(s):
−
== Reaction(s) known to produce the compound ==
+
** 1 a 1,2-diacyl-sn-glycerol[c] '''+''' 1 ATP[c] '''=>''' 1 a 1,2-diacyl-sn-glycerol 3-phosphate[c] '''+''' 1 H+[c] '''+''' 1 ADP[c]
−
* [[APAPT]]
+
 
−
* [[SPMDtmi]]
+
== Genes associated with this reaction  ==
−
== Reaction(s) of unknown directionality ==
+
Genes have been associated with this reaction based on different elements listed below.
−
* [[SPERMIDINESYN-RXN]]
+
* Gene: [[Tiso_gene_14560]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_1163]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_1420]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-7817]], type I lipoteichoic acid biosynthesis (S. aureus): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7817 PWY-7817]
 +
** '''7''' reactions found over '''16''' reactions in the full pathway
 +
* [[PWY-7039]], phosphatidate metabolism, as a signaling molecule: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7039 PWY-7039]
 +
** '''2''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 124-20-9
+
* RHEA:
−
* BIGG : spmd
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10272 10272]
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6992097 6992097]
+
** [http://www.genome.jp/dbget-bin/www_bget?R02240 R02240]
−
* HMDB : HMDB01257
+
* UNIPROT:
−
* LIGAND-CPD:
+
** [http://www.uniprot.org/uniprot/Q01583 Q01583]
−
** [http://www.genome.jp/dbget-bin/www_bget?C00315 C00315]
+
** [http://www.uniprot.org/uniprot/P49621 P49621]
−
* CHEMSPIDER:
+
** [http://www.uniprot.org/uniprot/P49619 P49619]
−
** [http://www.chemspider.com/Chemical-Structure.5360248.html 5360248]
+
** [http://www.uniprot.org/uniprot/P51556 P51556]
−
* CHEBI:
+
** [http://www.uniprot.org/uniprot/Q9JTJ7 Q9JTJ7]
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57834 57834]
+
** [http://www.uniprot.org/uniprot/Q9CGK9 Q9CGK9]
−
* METABOLIGHTS : MTBLC57834
+
** [http://www.uniprot.org/uniprot/Q9PIN8 Q9PIN8]
−
{{#set: smiles=C([N+])CC[N+]CCCC[N+]}}
+
** [http://www.uniprot.org/uniprot/O08560 O08560]
−
{{#set: common name=spermidine}}
+
** [http://www.uniprot.org/uniprot/P0ABN1 P0ABN1]
−
{{#set: inchi key=InChIKey=ATHGHQPFGPMSJY-UHFFFAOYSA-Q}}
+
** [http://www.uniprot.org/uniprot/P20192 P20192]
−
{{#set: molecular weight=148.271    }}
+
** [http://www.uniprot.org/uniprot/P23743 P23743]
−
{{#set: common name=N-(3-aminopropyl)butane-1,4-diamine}}
+
** [http://www.uniprot.org/uniprot/Q06119 Q06119]
−
{{#set: consumed by=SPERMINE-SYNTHASE-RXN|SPMDtmi|RXN-13414}}
+
** [http://www.uniprot.org/uniprot/Q03603 Q03603]
−
{{#set: produced by=APAPT|SPMDtmi}}
+
** [http://www.uniprot.org/uniprot/Q39017 Q39017]
−
{{#set: reversible reaction associated=SPERMIDINESYN-RXN}}
+
** [http://www.uniprot.org/uniprot/Q09103 Q09103]
 +
{{#set: direction=LEFT-TO-RIGHT}}
 +
{{#set: common name=diacylglycerol_kinase_catalytic_region}}
 +
{{#set: common name=diacylglycerol_kinase}}
 +
{{#set: common name=sphingosine_kinase_1}}
 +
{{#set: ec number=EC-2.7.1.107}}
 +
{{#set: gene associated=Tiso_gene_14560|Tiso_gene_1163|Tiso_gene_1420}}
 +
{{#set: in pathway=PWY-7817|PWY-7039}}
 +
{{#set: reconstruction category=orthology|annotation}}
 +
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Latest revision as of 20:09, 21 March 2018

Reaction DIACYLGLYKIN-RXN

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • diacylglycerol_kinase_catalytic_region
    • diacylglycerol_kinase
    • sphingosine_kinase_1
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 a 1,2-diacyl-sn-glycerol[c] + 1 ATP[c] => 1 a 1,2-diacyl-sn-glycerol 3-phosphate[c] + 1 H+[c] + 1 ADP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7817, type I lipoteichoic acid biosynthesis (S. aureus): PWY-7817
    • 7 reactions found over 16 reactions in the full pathway
  • PWY-7039, phosphatidate metabolism, as a signaling molecule: PWY-7039
    • 2 reactions found over 5 reactions in the full pathway

Reconstruction information

External links






Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=DIACYLGLYKIN-RXN&oldid=39794"