Difference between revisions of "Tiso gene 11386"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11670 CPD-11670] == * smiles: ** C(O)(=O)C1(CSC(N1)CC2(=CNC3(C2=CC(O)=CC=3))) * common name...")
(Created page with "Category:Gene == Gene Tiso_gene_11386 == * right end position: ** 12490 * transcription direction: ** POSITIVE * left end position: ** 7939 * centisome position: ** 36.877...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11670 CPD-11670] ==
+
== Gene Tiso_gene_11386 ==
−
* smiles:
+
* right end position:
−
** C(O)(=O)C1(CSC(N1)CC2(=CNC3(C2=CC(O)=CC=3)))
+
** 12490
−
* common name:
+
* transcription direction:
−
** 5-hydroxyindole thiazolidine carboxylate
+
** POSITIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=DFSPELNJAJEWOM-UHFFFAOYSA-N
+
** 7939
−
* molecular weight:
+
* centisome position:
−
** 278.325    
+
** 36.877556    
 
* Synonym(s):
 
* Synonym(s):
−
** 5-hydroxyindole thiazolidine carboxylic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[HISTALDEHYD-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-10779]]
+
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-synechocystis]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[HISTOLDEHYD-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-synechocystis]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-8001]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways associated ==
 +
* [[HISTSYN-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=12490}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=195334 195334]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEMSPIDER:
+
{{#set: left end position=7939}}
−
** [http://www.chemspider.com/Chemical-Structure.169392.html 169392]
+
{{#set: centisome position=36.877556   }}
−
{{#set: smiles=C(O)(=O)C1(CSC(N1)CC2(=CNC3(C2=CC(O)=CC=3)))}}
+
{{#set: reaction associated=HISTALDEHYD-RXN|HISTOLDEHYD-RXN|RXN-8001}}
−
{{#set: common name=5-hydroxyindole thiazolidine carboxylate}}
+
{{#set: pathway associated=HISTSYN-PWY}}
−
{{#set: inchi key=InChIKey=DFSPELNJAJEWOM-UHFFFAOYSA-N}}
+
−
{{#set: molecular weight=278.325   }}
+
−
{{#set: common name=5-hydroxyindole thiazolidine carboxylic acid}}
+
−
{{#set: reversible reaction associated=RXN-10779}}
+

Latest revision as of 19:09, 21 March 2018

Gene Tiso_gene_11386

  • right end position:
    • 12490
  • transcription direction:
    • POSITIVE
  • left end position:
    • 7939
  • centisome position:
    • 36.877556
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_11386&oldid=39814"