Difference between revisions of "CPD-11670"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HS HS] == * smiles: ** [SH2] * inchi key: ** InChIKey=RWSOTUBLDIXVET-UHFFFAOYSA-N * common name...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11670 CPD-11670] == * smiles: ** C(O)(=O)C1(CSC(N1)CC2(=CNC3(C2=CC(O)=CC=3))) * common name...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11670 CPD-11670] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(O)(=O)C1(CSC(N1)CC2(=CNC3(C2=CC(O)=CC=3))) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 5-hydroxyindole thiazolidine carboxylate |
+ | * inchi key: | ||
+ | ** InChIKey=DFSPELNJAJEWOM-UHFFFAOYSA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 278.325 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 5-hydroxyindole thiazolidine carboxylic acid |
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | + | * [[RXN-10779]] | |
− | + | ||
− | + | ||
− | + | ||
− | * [[RXN- | + | |
== External links == | == External links == | ||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=195334 195334] |
− | + | ||
− | + | ||
− | + | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
− | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.169392.html 169392] |
− | + | {{#set: smiles=C(O)(=O)C1(CSC(N1)CC2(=CNC3(C2=CC(O)=CC=3)))}} | |
− | + | {{#set: common name=5-hydroxyindole thiazolidine carboxylate}} | |
− | + | {{#set: inchi key=InChIKey=DFSPELNJAJEWOM-UHFFFAOYSA-N}} | |
− | {{#set: | + | {{#set: molecular weight=278.325 }} |
− | {{#set: inchi key=InChIKey= | + | {{#set: common name=5-hydroxyindole thiazolidine carboxylic acid}} |
− | + | {{#set: reversible reaction associated=RXN-10779}} | |
− | {{#set: molecular weight= | + | |
− | {{#set: common name= | + | |
− | + | ||
− | + | ||
− | {{#set: reversible reaction associated= | + |
Latest revision as of 20:09, 21 March 2018
Contents
Metabolite CPD-11670
- smiles:
- C(O)(=O)C1(CSC(N1)CC2(=CNC3(C2=CC(O)=CC=3)))
- common name:
- 5-hydroxyindole thiazolidine carboxylate
- inchi key:
- InChIKey=DFSPELNJAJEWOM-UHFFFAOYSA-N
- molecular weight:
- 278.325
- Synonym(s):
- 5-hydroxyindole thiazolidine carboxylic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links