Difference between revisions of "CPD-11670"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_1894 == * Synonym(s): == Reactions associated == * Reaction: 3.4.23.1-RXN ** Source: orthology-esiliculosus * Reaction: RXN-8443...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11670 CPD-11670] == * smiles: ** C(O)(=O)C1(CSC(N1)CC2(=CNC3(C2=CC(O)=CC=3))) * common name...")
 
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_1894 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11670 CPD-11670] ==
 +
* smiles:
 +
** C(O)(=O)C1(CSC(N1)CC2(=CNC3(C2=CC(O)=CC=3)))
 +
* common name:
 +
** 5-hydroxyindole thiazolidine carboxylate
 +
* inchi key:
 +
** InChIKey=DFSPELNJAJEWOM-UHFFFAOYSA-N
 +
* molecular weight:
 +
** 278.325   
 
* Synonym(s):
 
* Synonym(s):
 +
** 5-hydroxyindole thiazolidine carboxylic acid
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* Reaction: [[3.4.23.1-RXN]]
+
== Reaction(s) known to produce the compound ==
** Source: [[orthology-esiliculosus]]
+
== Reaction(s) of unknown directionality ==
* Reaction: [[RXN-8443]]
+
* [[RXN-10779]]
** Source: [[orthology-athaliana]]
+
** Source: [[orthology-esiliculosus]]
+
== Pathways associated ==
+
* [[PWY-5381]]
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=3.4.23.1-RXN|RXN-8443}}
+
* PUBCHEM:
{{#set: pathway associated=PWY-5381}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=195334 195334]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.169392.html 169392]
 +
{{#set: smiles=C(O)(=O)C1(CSC(N1)CC2(=CNC3(C2=CC(O)=CC=3)))}}
 +
{{#set: common name=5-hydroxyindole thiazolidine carboxylate}}
 +
{{#set: inchi key=InChIKey=DFSPELNJAJEWOM-UHFFFAOYSA-N}}
 +
{{#set: molecular weight=278.325    }}
 +
{{#set: common name=5-hydroxyindole thiazolidine carboxylic acid}}
 +
{{#set: reversible reaction associated=RXN-10779}}

Latest revision as of 20:09, 21 March 2018

Metabolite CPD-11670

  • smiles:
    • C(O)(=O)C1(CSC(N1)CC2(=CNC3(C2=CC(O)=CC=3)))
  • common name:
    • 5-hydroxyindole thiazolidine carboxylate
  • inchi key:
    • InChIKey=DFSPELNJAJEWOM-UHFFFAOYSA-N
  • molecular weight:
    • 278.325
  • Synonym(s):
    • 5-hydroxyindole thiazolidine carboxylic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links