Difference between revisions of "ASPARTATE-DEG1-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11876 CPD-11876] == * smiles: ** COC1(=C(O)C=CC(C(O)C=O)=C1) * inchi key: ** InChIKey=VISAJ...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=ASPARTATE-DEG1-PWY ASPARTATE-DEG1-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?ob...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=ASPARTATE-DEG1-PWY ASPARTATE-DEG1-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
* common name: | * common name: | ||
− | ** | + | ** L-aspartate degradation I |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''1''' reactions found over '''1''' reactions in the full pathway | |
− | + | * [[ASPAMINOTRANS-RXN]] | |
− | * [[ | + | ** 6 associated gene(s): |
+ | *** [[Tiso_gene_17718]] | ||
+ | *** [[Tiso_gene_6815]] | ||
+ | *** [[Tiso_gene_13538]] | ||
+ | *** [[Tiso_gene_15680]] | ||
+ | *** [[Tiso_gene_17809]] | ||
+ | *** [[Tiso_gene_12889]] | ||
+ | ** 7 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | + | {{#set: taxonomic range=TAX-2157}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=L-aspartate degradation I}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=1}} | |
− | + | {{#set: completion rate=100.0}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:09, 21 March 2018
Pathway ASPARTATE-DEG1-PWY
Reaction(s) found
1 reactions found over 1 reactions in the full pathway
- ASPAMINOTRANS-RXN
- 6 associated gene(s):
- 7 reconstruction source(s) associated: