Difference between revisions of "ALPHA-RIBAZOLE-5-P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13193 RXN-13193] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-RIBAZOLE-5-P ALPHA-RIBAZOLE-5-P] == * smiles: ** CC2(C(C)=CC1(N(C=NC=1C=2)C3(C(O)C(O)C(CO...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13193 RXN-13193] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-RIBAZOLE-5-P ALPHA-RIBAZOLE-5-P] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC2(C(C)=CC1(N(C=NC=1C=2)C3(C(O)C(O)C(COP([O-])(=O)[O-])O3)))
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/1.14.15.n EC-1.14.15.n]
+
** α-ribazole 5'-phosphate
 +
* inchi key:
 +
** InChIKey=ZMRGXEJKZPRBPJ-SYQHCUMBSA-L
 +
* molecular weight:
 +
** 356.271   
 
* Synonym(s):
 
* Synonym(s):
 +
** N1-(5'-phospho-α-D-ribosyl)-5,6-dimethylbenzimidazole
 +
** DMB-ribose-5'-P
 +
** α-ribazole-5'-P
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RIBAZOLEPHOSPHAT-RXN]]
−
** 4 [[Reduced-ferredoxins]][c] '''+''' 2 [[OXYGEN-MOLECULE]][c] '''+''' 4 [[PROTON]][c] '''+''' 1 [[CPD1F-130]][c] '''=>''' 2 [[WATER]][c] '''+''' 4 [[Oxidized-ferredoxins]][c] '''+''' 1 [[CPD1F-133]][c]
+
* [[R04594]]
−
* With common name(s):
+
== Reaction(s) known to produce the compound ==
−
** 4 a reduced ferredoxin [iron-sulfur] cluster[c] '''+''' 2 oxygen[c] '''+''' 4 H+[c] '''+''' 1 zeaxanthin[c] '''=>''' 2 H2O[c] '''+''' 4 an oxidized ferredoxin [iron-sulfur] cluster[c] '''+''' 1 violaxanthin[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
* [[RXN-16788]]
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_10919]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* LIGAND-CPD:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14944 14944]
+
** [http://www.genome.jp/dbget-bin/www_bget?C04778 C04778]
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14940 14940]
+
* HMDB : HMDB03882
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
−
{{#set: ec number=EC-1.14.15.n}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57918 57918]
−
{{#set: gene associated=Tiso_gene_10919}}
+
* BIGG : 5prdmbz
−
{{#set: in pathway=}}
+
* PUBCHEM:
−
{{#set: reconstruction category=orthology}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791947 49791947]
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: smiles=CC2(C(C)=CC1(N(C=NC=1C=2)C3(C(O)C(O)C(COP([O-])(=O)[O-])O3)))}}
−
{{#set: reconstruction source=esiliculosus}}
+
{{#set: common name=α-ribazole 5'-phosphate}}
 +
{{#set: inchi key=InChIKey=ZMRGXEJKZPRBPJ-SYQHCUMBSA-L}}
 +
{{#set: molecular weight=356.271    }}
 +
{{#set: common name=N1-(5'-phospho-α-D-ribosyl)-5,6-dimethylbenzimidazole|DMB-ribose-5'-P|α-ribazole-5'-P}}
 +
{{#set: consumed by=RIBAZOLEPHOSPHAT-RXN|R04594}}
 +
{{#set: reversible reaction associated=RXN-16788}}

Latest revision as of 20:09, 21 March 2018

Metabolite ALPHA-RIBAZOLE-5-P

  • smiles:
    • CC2(C(C)=CC1(N(C=NC=1C=2)C3(C(O)C(O)C(COP([O-])(=O)[O-])O3)))
  • common name:
    • α-ribazole 5'-phosphate
  • inchi key:
    • InChIKey=ZMRGXEJKZPRBPJ-SYQHCUMBSA-L
  • molecular weight:
    • 356.271
  • Synonym(s):
    • N1-(5'-phospho-α-D-ribosyl)-5,6-dimethylbenzimidazole
    • DMB-ribose-5'-P
    • α-ribazole-5'-P

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC2(C(C)=CC1(N(C=NC=1C=2)C3(C(O)C(O)C(COP([O-])(=O)[O-])O3)))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=ALPHA-RIBAZOLE-5-P&oldid=39850"