Difference between revisions of "Tiso gene 19650"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11876 CPD-11876] == * smiles: ** COC1(=C(O)C=CC(C(O)C=O)=C1) * inchi key: ** InChIKey=VISAJ...")
(Created page with "Category:Gene == Gene Tiso_gene_19650 == * right end position: ** 2014 * transcription direction: ** POSITIVE * left end position: ** 1900 * centisome position: ** 88.7435...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11876 CPD-11876] ==
+
== Gene Tiso_gene_19650 ==
−
* smiles:
+
* right end position:
−
** COC1(=C(O)C=CC(C(O)C=O)=C1)
+
** 2014
−
* inchi key:
+
* transcription direction:
−
** InChIKey=VISAJVAPYPFKCL-QMMMGPOBSA-N
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 3-methoxy-4-hydroxyphenylglycolaldehyde
+
** 1900
−
* molecular weight:
+
* centisome position:
−
** 182.176    
+
** 88.743576    
 
* Synonym(s):
 
* Synonym(s):
−
** MOPEGAL
 
−
** 4-hydroxy-3-methoxymandelaldehyde
 
−
** 3-methoxy 4-hydroxy mandelic aldehyde
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[3.1.1.47-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-10915]]
+
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=2014}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658114 90658114]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEMSPIDER:
+
{{#set: left end position=1900}}
−
** [http://www.chemspider.com/Chemical-Structure.389601.html 389601]
+
{{#set: centisome position=88.743576   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=3.1.1.47-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05583 C05583]
+
−
* HMDB : HMDB04061
+
−
{{#set: smiles=COC1(=C(O)C=CC(C(O)C=O)=C1)}}
+
−
{{#set: inchi key=InChIKey=VISAJVAPYPFKCL-QMMMGPOBSA-N}}
+
−
{{#set: common name=3-methoxy-4-hydroxyphenylglycolaldehyde}}
+
−
{{#set: molecular weight=182.176   }}
+
−
{{#set: common name=MOPEGAL|4-hydroxy-3-methoxymandelaldehyde|3-methoxy 4-hydroxy mandelic aldehyde}}
+
−
{{#set: reversible reaction associated=RXN-10915}}
+

Latest revision as of 19:09, 21 March 2018

Gene Tiso_gene_19650

  • right end position:
    • 2014
  • transcription direction:
    • POSITIVE
  • left end position:
    • 1900
  • centisome position:
    • 88.743576
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_19650&oldid=39851"