Difference between revisions of "Tiso gene 6621"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12177 CPD-12177] == * smiles: ** CC([CH]=O)C(=O)[O-] * inchi key: ** InChIKey=VOKUMXABRRXHA...")
(Created page with "Category:Gene == Gene Tiso_gene_6621 == * Synonym(s): == Reactions associated == * Reaction: RXN-1882 ** Source: orthology-athaliana ** Source: orthology-esilic...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12177 CPD-12177] ==
+
== Gene Tiso_gene_6621 ==
* smiles:
+
** CC([CH]=O)C(=O)[O-]
+
* inchi key:
+
** InChIKey=VOKUMXABRRXHAR-GSVOUGTGSA-M
+
* common name:
+
** (R)-methylmalonate-semialdehyde
+
* molecular weight:
+
** 101.082   
+
 
* Synonym(s):
 
* Synonym(s):
** (R)-2-methyl-3-oxopropanoate
 
** (R)-ch3-malonate-semialdehyde
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-1882]]
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-athaliana]]
* [[RXN-14056]]
+
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-7771]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-7772]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY4FS-11]]
 +
* [[PWY4FS-12]]
 +
* [[PWY4FS-13]]
 +
* [[PWY-5115]]
 +
* [[PWY-882]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=RXN-1882|RXN-7771|RXN-7772}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173310 46173310]
+
{{#set: pathway associated=PWY4FS-11|PWY4FS-12|PWY4FS-13|PWY-5115|PWY-882}}
{{#set: smiles=CC([CH]=O)C(=O)[O-]}}
+
{{#set: inchi key=InChIKey=VOKUMXABRRXHAR-GSVOUGTGSA-M}}
+
{{#set: common name=(R)-methylmalonate-semialdehyde}}
+
{{#set: molecular weight=101.082    }}
+
{{#set: common name=(R)-2-methyl-3-oxopropanoate|(R)-ch3-malonate-semialdehyde}}
+
{{#set: reversible reaction associated=RXN-14056}}
+

Latest revision as of 19:09, 21 March 2018

Gene Tiso_gene_6621

  • Synonym(s):

Reactions associated

Pathways associated

External links