Difference between revisions of "Tiso gene 10881"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12177 CPD-12177] == * smiles: ** CC([CH]=O)C(=O)[O-] * common name: ** (R)-methylmalonate-s...")
(Created page with "Category:Gene == Gene Tiso_gene_10881 == * right end position: ** 6863 * transcription direction: ** POSITIVE * left end position: ** 3062 * centisome position: ** 37.2143...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12177 CPD-12177] ==
+
== Gene Tiso_gene_10881 ==
−
* smiles:
+
* right end position:
−
** CC([CH]=O)C(=O)[O-]
+
** 6863
−
* common name:
+
* transcription direction:
−
** (R)-methylmalonate-semialdehyde
+
** POSITIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=VOKUMXABRRXHAR-GSVOUGTGSA-M
+
** 3062
−
* molecular weight:
+
* centisome position:
−
** 101.082    
+
** 37.21439    
 
* Synonym(s):
 
* Synonym(s):
−
** (R)-2-methyl-3-oxopropanoate
 
−
** (R)-ch3-malonate-semialdehyde
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[CYSTEINE--TRNA-LIGASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-14056]]
+
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[TRNA-CHARGING-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=6863}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173310 46173310]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CC([CH]=O)C(=O)[O-]}}
+
{{#set: left end position=3062}}
−
{{#set: common name=(R)-methylmalonate-semialdehyde}}
+
{{#set: centisome position=37.21439   }}
−
{{#set: inchi key=InChIKey=VOKUMXABRRXHAR-GSVOUGTGSA-M}}
+
{{#set: reaction associated=CYSTEINE--TRNA-LIGASE-RXN}}
−
{{#set: molecular weight=101.082   }}
+
{{#set: pathway associated=TRNA-CHARGING-PWY}}
−
{{#set: common name=(R)-2-methyl-3-oxopropanoate|(R)-ch3-malonate-semialdehyde}}
+
−
{{#set: reversible reaction associated=RXN-14056}}
+

Latest revision as of 19:09, 21 March 2018

Gene Tiso_gene_10881

  • right end position:
    • 6863
  • transcription direction:
    • POSITIVE
  • left end position:
    • 3062
  • centisome position:
    • 37.21439
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_10881&oldid=39857"