Difference between revisions of "Tiso gene 13211"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18489 CPD-18489] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(...")
 
(Created page with "Category:Gene == Gene Tiso_gene_13211 == * right end position: ** 6176 * transcription direction: ** POSITIVE * left end position: ** 2240 * centisome position: ** 34.7071...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18489 CPD-18489] ==
+
== Gene Tiso_gene_13211 ==
−
* smiles:
+
* right end position:
−
** CCCCCC=CCC=CCC=CCC=CCCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** 6176
−
* inchi key:
+
* transcription direction:
−
** InChIKey=DMYSJGJJPTXMAW-JJKILJMSSA-J
+
** POSITIVE
−
* common name:
+
* left end position:
−
** (3R)-hydroxy-tetracosatetraenoyl-CoA
+
** 2240
−
* molecular weight:
+
* centisome position:
−
** 1122.065    
+
** 34.707157    
 
* Synonym(s):
 
* Synonym(s):
−
** (3R)-hydroxy-(9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoyl-CoA
 
−
** (3R)-hydroxy-(9Z,12Z,15Z,18Z)-tetracosatetraenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[ATPASE-RXN]]
−
* [[RXN-17109]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=6176}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193803 72193803]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=2240}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76417 76417]
+
{{#set: centisome position=34.707157   }}
−
{{#set: smiles=CCCCCC=CCC=CCC=CCC=CCCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: reaction associated=ATPASE-RXN}}
−
{{#set: inchi key=InChIKey=DMYSJGJJPTXMAW-JJKILJMSSA-J}}
+
−
{{#set: common name=(3R)-hydroxy-tetracosatetraenoyl-CoA}}
+
−
{{#set: molecular weight=1122.065   }}
+
−
{{#set: common name=(3R)-hydroxy-(9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoyl-CoA|(3R)-hydroxy-(9Z,12Z,15Z,18Z)-tetracosatetraenoyl-CoA}}
+
−
{{#set: produced by=RXN-17109}}
+

Latest revision as of 20:09, 21 March 2018

Gene Tiso_gene_13211

  • right end position:
    • 6176
  • transcription direction:
    • POSITIVE
  • left end position:
    • 2240
  • centisome position:
    • 34.707157
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_13211&oldid=39862"