Difference between revisions of "Unwound-DNA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7953 CPD-7953] == * smiles: ** CC(=CC=CC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCCC=1C)(C)C...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Unwound-DNA Unwound-DNA] == * common name: ** an unwound double-stranded DNA * Synonym(s): ==...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7953 CPD-7953] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Unwound-DNA Unwound-DNA] ==
* smiles:
+
** CC(=CC=CC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCCC=1C)(C)C))C)C)C)C)C)C
+
* inchi key:
+
** InChIKey=AIBOHNYYKWYQMM-IQKLXLPLSA-N
+
 
* common name:
 
* common name:
** torulene
+
** an unwound double-stranded DNA
* molecular weight:
+
** 534.867   
+
 
* Synonym(s):
 
* Synonym(s):
** 3',4'-didehydro-β,ψ-carotene
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11989]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-11135]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an unwound double-stranded DNA}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10218186 10218186]
+
{{#set: reversible reaction associated=RXN-11135}}
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.8393678.html 8393678]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=9638 9638]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C08613 C08613]
+
{{#set: smiles=CC(=CC=CC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCCC=1C)(C)C))C)C)C)C)C)C}}
+
{{#set: inchi key=InChIKey=AIBOHNYYKWYQMM-IQKLXLPLSA-N}}
+
{{#set: common name=torulene}}
+
{{#set: molecular weight=534.867    }}
+
{{#set: common name=3',4'-didehydro-β,ψ-carotene}}
+
{{#set: consumed by=RXN-11989}}
+

Latest revision as of 19:09, 21 March 2018

Metabolite Unwound-DNA

  • common name:
    • an unwound double-stranded DNA
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links