Difference between revisions of "Tiso gene 12629"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRYPTAMINE TRYPTAMINE] == * smiles: ** C([N+])CC2(=CNC1(=C(C=CC=C1)2)) * common name: ** trypta...") |
(Created page with "Category:Gene == Gene Tiso_gene_12629 == * right end position: ** 3463 * transcription direction: ** POSITIVE * left end position: ** 685 * centisome position: ** 10.04546...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_12629 == |
− | * | + | * right end position: |
− | ** | + | ** 3463 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 685 |
− | * | + | * centisome position: |
− | ** | + | ** 10.045462 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[5.99.1.3-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: ec-number |
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=3463}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=685}} | |
− | + | {{#set: centisome position=10.045462 }} | |
− | + | {{#set: reaction associated=5.99.1.3-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:09, 21 March 2018
Gene Tiso_gene_12629
- right end position:
- 3463
- transcription direction:
- POSITIVE
- left end position:
- 685
- centisome position:
- 10.045462
- Synonym(s):
Reactions associated
- Reaction: 5.99.1.3-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation