Difference between revisions of "RXN-14120"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-694 CPD-694] == * smiles: ** CC6(=C7(C(C([CH]8(C2([N+]1([Co---]4([N+]3(C(=C(C)C=1C(CCC([O-]...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14120 RXN-14120] == * direction: ** REVERSIBLE * common name: ** ORF ** nucleoside_diphosphate_...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-694 CPD-694] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14120 RXN-14120] ==
−
* smiles:
+
* direction:
−
** CC6(=C7(C(C([CH]8(C2([N+]1([Co---]4([N+]3(C(=C(C)C=1C(CCC([O-])=O)C(CC(=O)N)(C)2)C(C(CCC(=O)[O-])C=3C=C5(C(C)(C)C(CCC(=O)[O-])C(=[N+]45)6))(CC(=O)N)C))N78))C))CC(=O)[O-])(C)CCC(=O)[O-]))
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=NKLHEMWEQJCPPF-OKJGWHJPSA-H
+
 
* common name:
 
* common name:
−
** cob(I)yrinate a,c-diamide
+
** ORF
−
* molecular weight:
+
** nucleoside_diphosphate_kinase
−
** 931.9   
+
** adenylate_kinase_domain-containing_protein_1
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.7.4.6 EC-2.7.4.6]
 
* Synonym(s):
 
* Synonym(s):
−
** cob(I)yrinic acid a,c-diamide
 
−
** Cob(I)yrinate diamide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[R344-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[IDP]][c] '''+''' 1 [[ATP]][c] '''<=>''' 1 [[ITP]][c] '''+''' 1 [[ADP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 IDP[c] '''+''' 1 ATP[c] '''<=>''' 1 ITP[c] '''+''' 1 ADP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_195]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_17271]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_17272]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_9290]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_18224]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_16529]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266689 45266689]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30350 30350]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58575 58575]
+
** [http://www.genome.jp/dbget-bin/www_bget?R00722 R00722]
−
* LIGAND-CPD:
+
{{#set: direction=REVERSIBLE}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06505 C06505]
+
{{#set: common name=ORF}}
−
* HMDB : HMDB06904
+
{{#set: common name=nucleoside_diphosphate_kinase}}
−
{{#set: smiles=CC6(=C7(C(C([CH]8(C2([N+]1([Co---]4([N+]3(C(=C(C)C=1C(CCC([O-])=O)C(CC(=O)N)(C)2)C(C(CCC(=O)[O-])C=3C=C5(C(C)(C)C(CCC(=O)[O-])C(=[N+]45)6))(CC(=O)N)C))N78))C))CC(=O)[O-])(C)CCC(=O)[O-]))}}
+
{{#set: common name=adenylate_kinase_domain-containing_protein_1}}
−
{{#set: inchi key=InChIKey=NKLHEMWEQJCPPF-OKJGWHJPSA-H}}
+
{{#set: ec number=EC-2.7.4.6}}
−
{{#set: common name=cob(I)yrinate a,c-diamide}}
+
{{#set: gene associated=Tiso_gene_195|Tiso_gene_17271|Tiso_gene_17272|Tiso_gene_9290|Tiso_gene_18224|Tiso_gene_16529}}
−
{{#set: molecular weight=931.9    }}
+
{{#set: in pathway=}}
−
{{#set: common name=cob(I)yrinic acid a,c-diamide|Cob(I)yrinate diamide}}
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: consumed by=R344-RXN}}
+
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-athaliana|annotation-experimental_annotation|orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Latest revision as of 19:10, 21 March 2018

Reaction RXN-14120

  • direction:
    • REVERSIBLE
  • common name:
    • ORF
    • nucleoside_diphosphate_kinase
    • adenylate_kinase_domain-containing_protein_1
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 IDP[c] + 1 ATP[c] <=> 1 ITP[c] + 1 ADP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links






Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-14120&oldid=39885"