Difference between revisions of "ENT-KAUR-16-EN-19-OL"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Beta-D-Glucans Beta-D-Glucans] == * common name: ** a β-D glucan * Synonym(s): == Reactio...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ENT-KAUR-16-EN-19-OL ENT-KAUR-16-EN-19-OL] == * smiles: ** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(CO)CCCC...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Beta-D-Glucans Beta-D-Glucans] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ENT-KAUR-16-EN-19-OL ENT-KAUR-16-EN-19-OL] ==
 +
* smiles:
 +
** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(CO)CCCC(C)2[CH]3CC4))))
 
* common name:
 
* common name:
−
** a β-D glucan
+
** ent-kaurenol
 +
* inchi key:
 +
** InChIKey=TUJQVRFWMWRMIO-XRNRSJMDSA-N
 +
* molecular weight:
 +
** 288.472   
 
* Synonym(s):
 
* Synonym(s):
 +
** ent-kaur-16-en-19-ol
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-5242]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[3.2.1.6-RXN]]
+
* [[1.14.13.78-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
{{#set: common name=a β-D glucan}}
+
* PUBCHEM:
−
{{#set: produced by=3.2.1.6-RXN}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=443465 443465]
 +
* HMDB : HMDB36727
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29611 29611]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C11872 C11872]
 +
{{#set: smiles=C=C1(C4(CC3(C1)(CC[CH]2(C(C)(CO)CCCC(C)2[CH]3CC4))))}}
 +
{{#set: common name=ent-kaurenol}}
 +
{{#set: inchi key=InChIKey=TUJQVRFWMWRMIO-XRNRSJMDSA-N}}
 +
{{#set: molecular weight=288.472    }}
 +
{{#set: common name=ent-kaur-16-en-19-ol}}
 +
{{#set: consumed by=RXN-5242}}
 +
{{#set: produced by=1.14.13.78-RXN}}

Latest revision as of 19:10, 21 March 2018

Metabolite ENT-KAUR-16-EN-19-OL

  • smiles:
    • C=C1(C4(CC3(C1)(CC[CH]2(C(C)(CO)CCCC(C)2[CH]3CC4))))
  • common name:
    • ent-kaurenol
  • inchi key:
    • InChIKey=TUJQVRFWMWRMIO-XRNRSJMDSA-N
  • molecular weight:
    • 288.472
  • Synonym(s):
    • ent-kaur-16-en-19-ol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C4(CC3(C1)(CC[CH]2(C(C)(CO)CCCC(C)2[CH]3CC4))))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=ENT-KAUR-16-EN-19-OL&oldid=39902"