Difference between revisions of "DNA-Combined-With-Exogenous-DNA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-COUMAROYL-COA P-COUMAROYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=CC(O)=...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DNA-Combined-With-Exogenous-DNA DNA-Combined-With-Exogenous-DNA] == * common name: ** DNA combi...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-COUMAROYL-COA P-COUMAROYL-COA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DNA-Combined-With-Exogenous-DNA DNA-Combined-With-Exogenous-DNA] ==
−
* smiles:
+
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=CC(O)=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
−
* inchi key:
+
−
** InChIKey=DMZOKBALNZWDKI-MATMFAIHSA-J
+
 
* common name:
 
* common name:
−
** 4-coumaroyl-CoA
+
** DNA combined with exogenous DNA to form a recombinational junction
−
* molecular weight:
+
−
** 909.648   
+
 
* Synonym(s):
 
* Synonym(s):
−
** p-coumaroyl-CoA
 
−
** 4-hydroxycinnamoyl-CoA
 
−
** 4-coumaryl-CoA
 
−
** p-coumaryl-CoA
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-11244]]
+
* [[3.1.22.4-RXN]]
−
* [[RXN-1101]]
+
−
* [[RXN-3142]]
+
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[4-COUMARATE--COA-LIGASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=DNA combined with exogenous DNA to form a recombinational junction}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266584 45266584]
+
{{#set: consumed by=3.1.22.4-RXN}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15499 15499]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00223 C00223]
+
−
* HMDB : HMDB60153
+
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=CC(O)=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=DMZOKBALNZWDKI-MATMFAIHSA-J}}
+
−
{{#set: common name=4-coumaroyl-CoA}}
+
−
{{#set: molecular weight=909.648    }}
+
−
{{#set: common name=p-coumaroyl-CoA|4-hydroxycinnamoyl-CoA|4-coumaryl-CoA|p-coumaryl-CoA}}
+
−
{{#set: consumed by=RXN-11244|RXN-1101|RXN-3142}}
+
−
{{#set: produced by=4-COUMARATE--COA-LIGASE-RXN}}
+

Latest revision as of 20:10, 21 March 2018

Metabolite DNA-Combined-With-Exogenous-DNA

  • common name:
    • DNA combined with exogenous DNA to form a recombinational junction
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=DNA-Combined-With-Exogenous-DNA&oldid=39906"