Difference between revisions of "PWY-6313"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1086 CPD-1086] == * smiles: ** C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)COP([O-])(=O)[O-] * in...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6313 PWY-6313] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-3...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6313 PWY-6313] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** serotonin degradation |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''6''' reactions found over '''7''' reactions in the full pathway | |
| − | * [[RXN- | + | * [[RXN-10777]] |
| − | * [[ | + | ** 1 associated gene(s): |
| − | == Reaction(s) | + | *** [[Tiso_gene_5505]] |
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[RXN-10779]] | ||
| + | ** 0 associated gene: | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | * [[RXN-10780]] | ||
| + | ** 2 associated gene(s): | ||
| + | *** [[Tiso_gene_7322]] | ||
| + | *** [[Tiso_gene_3513]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[orthology-athaliana]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[RXN-10781]] | ||
| + | ** 5 associated gene(s): | ||
| + | *** [[Tiso_gene_6562]] | ||
| + | *** [[Tiso_gene_7649]] | ||
| + | *** [[Tiso_gene_5424]] | ||
| + | *** [[Tiso_gene_6563]] | ||
| + | *** [[Tiso_gene_5425]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | * [[RXN-10782]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Tiso_gene_5505]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[RXN-10784]] | ||
| + | ** 2 associated gene(s): | ||
| + | *** [[Tiso_gene_14140]] | ||
| + | *** [[Tiso_gene_14141]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-10778 RXN-10778] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-33208}} | |
| − | + | {{#set: common name=serotonin degradation}} | |
| − | + | {{#set: reaction found=6}} | |
| − | + | {{#set: total reaction=7}} | |
| − | + | {{#set: completion rate=86.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:10, 21 March 2018
Pathway PWY-6313
- taxonomic range:
- common name:
- serotonin degradation
- Synonym(s):
Reaction(s) found
6 reactions found over 7 reactions in the full pathway
- RXN-10777
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-10779
- 0 associated gene:
- 1 reconstruction source(s) associated:
- RXN-10780
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN-10781
- 5 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-10782
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-10784
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
