Difference between revisions of "Octadec-2-enoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARYL-ALCOHOL COUMARYL-ALCOHOL] == * smiles: ** C(=CC1(=CC=C(O)C=C1))CO * inchi key: ** InCh...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Octadec-2-enoyl-ACPs Octadec-2-enoyl-ACPs] == * common name: ** a trans-octadec-2-enoyl-[acp] *...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARYL-ALCOHOL COUMARYL-ALCOHOL] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Octadec-2-enoyl-ACPs Octadec-2-enoyl-ACPs] ==
* smiles:
+
** C(=CC1(=CC=C(O)C=C1))CO
+
* inchi key:
+
** InChIKey=PTNLHDGQWUGONS-OWOJBTEDSA-N
+
 
* common name:
 
* common name:
** 4-coumaryl alcohol
+
** a trans-octadec-2-enoyl-[acp]
* molecular weight:
+
** 150.177   
+
 
* Synonym(s):
 
* Synonym(s):
** p-coumaryl alcohol
+
** trans-2,3-stearoyl-[acp]
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN3O-5293]]
 +
* [[RXN-9635]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-1102]]
+
* [[RXN-9634]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[R369]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a trans-octadec-2-enoyl-[acp]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280535 5280535]
+
{{#set: common name=trans-2,3-stearoyl-[acp]}}
* CHEMSPIDER:
+
{{#set: consumed by=RXN3O-5293|RXN-9635}}
** [http://www.chemspider.com/Chemical-Structure.4444166.html 4444166]
+
{{#set: produced by=RXN-9634}}
* CHEBI:
+
{{#set: reversible reaction associated=R369}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28386 28386]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C02646 C02646]
+
* HMDB : HMDB03654
+
{{#set: smiles=C(=CC1(=CC=C(O)C=C1))CO}}
+
{{#set: inchi key=InChIKey=PTNLHDGQWUGONS-OWOJBTEDSA-N}}
+
{{#set: common name=4-coumaryl alcohol}}
+
{{#set: molecular weight=150.177    }}
+
{{#set: common name=p-coumaryl alcohol}}
+
{{#set: produced by=RXN-1102}}
+

Latest revision as of 20:10, 21 March 2018

Metabolite Octadec-2-enoyl-ACPs

  • common name:
    • a trans-octadec-2-enoyl-[acp]
  • Synonym(s):
    • trans-2,3-stearoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a trans-octadec-2-enoyl-[acp" cannot be used as a page name in this wiki.
"trans-2,3-stearoyl-[acp" cannot be used as a page name in this wiki.