Difference between revisions of "RXN-18204"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYS-GLY CYS-GLY] == * smiles: ** C(C([O-])=O)NC(C(CS)[N+])=O * common name: ** L-cysteinyl-glyc...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18204 RXN-18204] == * direction: ** REVERSIBLE * common name: ** 3-isopropylmalate dehydrogenas...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18204 RXN-18204] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
* common name: | * common name: | ||
| − | ** | + | ** 3-isopropylmalate dehydrogenase |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | = | + | ** 1 [[CPDQT-38]][c] '''+''' 1 [[NAD]][c] '''<=>''' 1 [[CPD-19489]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] |
| − | * [[ | + | * With common name(s): |
| − | * [[ | + | ** 1 3-(5'-methylthio)pentylmalate[c] '''+''' 1 NAD+[c] '''<=>''' 1 3-isopropyl-8-(methylthio)-2-oxooctanoate[c] '''+''' 1 NADH[c] '''+''' 1 H+[c] |
| − | * [[ | + | |
| − | == | + | == Genes associated with this reaction == |
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_2920]] | ||
| + | ** Source: [[annotation-experimental_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | == Pathways == | ||
| + | * [[PWYQT-4450]], aliphatic glucosinolate biosynthesis, side chain elongation cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWYQT-4450 PWYQT-4450] | ||
| + | ** '''10''' reactions found over '''30''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-experimental_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: common name=3-isopropylmalate dehydrogenase}} | |
| − | + | {{#set: gene associated=Tiso_gene_2920}} | |
| − | + | {{#set: in pathway=PWYQT-4450}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-experimental_annotation}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:10, 21 March 2018
Contents
Reaction RXN-18204
- direction:
- REVERSIBLE
- common name:
- 3-isopropylmalate dehydrogenase
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 3-(5'-methylthio)pentylmalate[c] + 1 NAD+[c] <=> 1 3-isopropyl-8-(methylthio)-2-oxooctanoate[c] + 1 NADH[c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_2920
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
Pathways
- PWYQT-4450, aliphatic glucosinolate biosynthesis, side chain elongation cycle: PWYQT-4450
- 10 reactions found over 30 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
