Difference between revisions of "CYS-GLY"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_11478 == * left end position: ** 3970 * transcription direction: ** POSITIVE * right end position: ** 7258 * centisome position: ** 51.0348...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYS-GLY CYS-GLY] == * smiles: ** C(C([O-])=O)NC(C(CS)[N+])=O * common name: ** L-cysteinyl-glyc...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYS-GLY CYS-GLY] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(C([O-])=O)NC(C(CS)[N+])=O |
| − | * | + | * common name: |
| − | ** | + | ** L-cysteinyl-glycine |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=ZUKPVRWZDMRIEO-VKHMYHEASA-N |
| − | * | + | * molecular weight: |
| − | ** | + | ** 178.206 |
* Synonym(s): | * Synonym(s): | ||
| + | ** Cys-Gly | ||
| + | ** cysteinylglycine | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[RXN- | + | * [[RXN-6622]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-6601]] | |
| − | + | * [[RXN-18092]] | |
| − | + | * [[RXN-9157]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * [[RXN- | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | * [[RXN- | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | * [[RXN- | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * BIGG : cgly |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7098621 7098621] |
| − | {{#set: | + | * HMDB : HMDB00078 |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01419 C01419] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61694 61694] | ||
| + | * METABOLIGHTS : MTBLC4047 | ||
| + | {{#set: smiles=C(C([O-])=O)NC(C(CS)[N+])=O}} | ||
| + | {{#set: common name=L-cysteinyl-glycine}} | ||
| + | {{#set: inchi key=InChIKey=ZUKPVRWZDMRIEO-VKHMYHEASA-N}} | ||
| + | {{#set: molecular weight=178.206 }} | ||
| + | {{#set: common name=Cys-Gly|cysteinylglycine}} | ||
| + | {{#set: consumed by=RXN-6622}} | ||
| + | {{#set: produced by=RXN-6601|RXN-18092|RXN-9157}} | ||
Latest revision as of 19:10, 21 March 2018
Contents
Metabolite CYS-GLY
- smiles:
- C(C([O-])=O)NC(C(CS)[N+])=O
- common name:
- L-cysteinyl-glycine
- inchi key:
- InChIKey=ZUKPVRWZDMRIEO-VKHMYHEASA-N
- molecular weight:
- 178.206
- Synonym(s):
- Cys-Gly
- cysteinylglycine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : cgly
- PUBCHEM:
- HMDB : HMDB00078
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC4047
"C(C([O-])=O)NC(C(CS)[N+])=O" cannot be used as a page name in this wiki.
