Difference between revisions of "INDOLE-3-GLYCEROL-P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-482 RXN66-482] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCEROL-P INDOLE-3-GLYCEROL-P] == * smiles: ** C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-482 RXN66-482] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCEROL-P INDOLE-3-GLYCEROL-P] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O)[O-])O)O)
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/1.3.1.38 EC-1.3.1.38]
+
** (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate
 +
* inchi key:
 +
** InChIKey=NQEQTYPJSIEPHW-MNOVXSKESA-L
 +
* molecular weight:
 +
** 285.193   
 
* Synonym(s):
 
* Synonym(s):
 +
** C1-(3-Indolyl)-glycerol 3-phosphate
 +
** indole-3-glycerol-P
 +
** 1-(indol-3-yl)glycerol-3-P
 +
** 1-(indol-3-yl)glycerol-3-phosphate
 +
** indoleglycerol phosphate
 +
** indole-3-glycerol-phosphate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[TRYPSYN-RXN]]
−
** 1 [[CPD-14928]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[CPD-206]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[IGPSYN-RXN]]
−
** 1 phytenoyl-CoA[c] '''+''' 1 H+[c] '''+''' 1 NADPH[c] '''=>''' 1 NADP+[c] '''+''' 1 phytanoyl-CoA[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
* [[RXN0-2381]]
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_10337]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
* Gene: [[Tiso_gene_18040]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
* Gene: [[Tiso_gene_18041]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY66-389]], phytol degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-389 PWY66-389]
+
−
** '''4''' reactions found over '''4''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: ec number=EC-1.3.1.38}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878464 46878464]
−
{{#set: gene associated=Tiso_gene_10337|Tiso_gene_18040|Tiso_gene_18041}}
+
* CHEBI:
−
{{#set: in pathway=PWY66-389}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58866 58866]
−
{{#set: reconstruction category=orthology}}
+
* BIGG : 3ig3p
−
{{#set: reconstruction source=orthology-esiliculosus}}
+
* LIGAND-CPD:
−
{{#set: reconstruction tool=pantograph}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C03506 C03506]
 +
{{#set: smiles=C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O)[O-])O)O)}}
 +
{{#set: common name=(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate}}
 +
{{#set: inchi key=InChIKey=NQEQTYPJSIEPHW-MNOVXSKESA-L}}
 +
{{#set: molecular weight=285.193    }}
 +
{{#set: common name=C1-(3-Indolyl)-glycerol 3-phosphate|indole-3-glycerol-P|1-(indol-3-yl)glycerol-3-P|1-(indol-3-yl)glycerol-3-phosphate|indoleglycerol phosphate|indole-3-glycerol-phosphate}}
 +
{{#set: consumed by=TRYPSYN-RXN}}
 +
{{#set: produced by=IGPSYN-RXN}}
 +
{{#set: reversible reaction associated=RXN0-2381}}

Latest revision as of 20:10, 21 March 2018

Metabolite INDOLE-3-GLYCEROL-P

  • smiles:
    • C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O)[O-])O)O)
  • common name:
    • (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate
  • inchi key:
    • InChIKey=NQEQTYPJSIEPHW-MNOVXSKESA-L
  • molecular weight:
    • 285.193
  • Synonym(s):
    • C1-(3-Indolyl)-glycerol 3-phosphate
    • indole-3-glycerol-P
    • 1-(indol-3-yl)glycerol-3-P
    • 1-(indol-3-yl)glycerol-3-phosphate
    • indoleglycerol phosphate
    • indole-3-glycerol-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O)[O-])O)O)" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=INDOLE-3-GLYCEROL-P&oldid=39957"