Difference between revisions of "PYRAZINAMIDE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-482 RXN66-482] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRAZINAMIDE PYRAZINAMIDE] == * smiles: ** C1(N=CC=NC=1C(=O)N) * common name: ** pyrazinamide *...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-482 RXN66-482] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRAZINAMIDE PYRAZINAMIDE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C1(N=CC=NC=1C(=O)N)
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/1.3.1.38 EC-1.3.1.38]
+
** pyrazinamide
 +
* inchi key:
 +
** InChIKey=IPEHBUMCGVEMRF-UHFFFAOYSA-N
 +
* molecular weight:
 +
** 123.114   
 
* Synonym(s):
 
* Synonym(s):
 +
** pyrazinecarboxamide
 +
** pyrazinoic acid amide
 +
** pyrazine carboxylamide
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[PYRAZIN-RXN]]
−
** 1 [[PROTON]][c] '''+''' 1 [[CPD-14928]][c] '''+''' 1 [[NADPH]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[CPD-206]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H+[c] '''+''' 1 phytenoyl-CoA[c] '''+''' 1 NADPH[c] '''=>''' 1 NADP+[c] '''+''' 1 phytanoyl-CoA[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_18040]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_10337]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_18041]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY66-389]], phytol degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-389 PWY66-389]
+
−
** '''4''' reactions found over '''4''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: ec number=EC-1.3.1.38}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1046 1046]
−
{{#set: gene associated=Tiso_gene_18040|Tiso_gene_10337|Tiso_gene_18041}}
+
* DRUGBANK : DB00339
−
{{#set: in pathway=PWY66-389}}
+
* NCI:
−
{{#set: reconstruction category=orthology}}
+
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=14911 14911]
−
{{#set: reconstruction tool=pantograph}}
+
* HMDB : HMDB14483
−
{{#set: reconstruction source=esiliculosus}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C01956 C01956]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.1017.html 1017]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=45285 45285]
 +
{{#set: smiles=C1(N=CC=NC=1C(=O)N)}}
 +
{{#set: common name=pyrazinamide}}
 +
{{#set: inchi key=InChIKey=IPEHBUMCGVEMRF-UHFFFAOYSA-N}}
 +
{{#set: molecular weight=123.114    }}
 +
{{#set: common name=pyrazinecarboxamide|pyrazinoic acid amide|pyrazine carboxylamide}}
 +
{{#set: consumed by=PYRAZIN-RXN}}

Latest revision as of 19:10, 21 March 2018

Metabolite PYRAZINAMIDE

  • smiles:
    • C1(N=CC=NC=1C(=O)N)
  • common name:
    • pyrazinamide
  • inchi key:
    • InChIKey=IPEHBUMCGVEMRF-UHFFFAOYSA-N
  • molecular weight:
    • 123.114
  • Synonym(s):
    • pyrazinecarboxamide
    • pyrazinoic acid amide
    • pyrazine carboxylamide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PYRAZINAMIDE&oldid=39976"