Difference between revisions of "PWY-7204"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5P SHIKIMATE-5P] == * smiles: ** C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1) * inc...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7204 PWY-7204] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5P SHIKIMATE-5P] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7204 PWY-7204] ==
−
* smiles:
+
* taxonomic range:
−
** C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
−
* inchi key:
+
−
** InChIKey=QYOJSKGCWNAKGW-PBXRRBTRSA-K
+
 
* common name:
 
* common name:
−
** shikimate 3-phosphate
+
** pyridoxal 5'-phosphate salvage II (plants)
−
* molecular weight:
+
−
** 251.109   
+
 
* Synonym(s):
 
* Synonym(s):
−
** shikimate 5-phosphate
+
** vitamin B6 salvage (plants)
−
** shikimate-5-P
+
−
** 3-phosphoshikimate
+
−
** shikimate-3-P
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''8''' reactions found over '''9''' reactions in the full pathway
−
== Reaction(s) of unknown directionality ==
+
* [[3.1.3.74-RXN]]
−
* [[2.5.1.19-RXN]]
+
** 1 associated gene(s):
−
* [[SHIKIMATE-KINASE-RXN]]
+
*** [[Tiso_gene_18054]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-creinhardtii]]
 +
* [[PMPOXI-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_1471]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[PNKIN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_6106]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-esiliculosus]]
 +
* [[PNPOXI-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_1471]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[PYRAMKIN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_6106]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-esiliculosus]]
 +
* [[PYRIDOXINE-4-DEHYDROGENASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_18748]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[PYRIDOXKIN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_6106]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-14181]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_18054]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-creinhardtii]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14046 RXN-14046]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-33090}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14506806 14506806]
+
{{#set: common name=pyridoxal 5'-phosphate salvage II (plants)}}
−
* CHEBI:
+
{{#set: common name=vitamin B6 salvage (plants)}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=145989 145989]
+
{{#set: reaction found=8}}
−
* BIGG : skm5p
+
{{#set: total reaction=9}}
−
* LIGAND-CPD:
+
{{#set: completion rate=89.0}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03175 C03175]
+
−
{{#set: smiles=C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1)}}
+
−
{{#set: inchi key=InChIKey=QYOJSKGCWNAKGW-PBXRRBTRSA-K}}
+
−
{{#set: common name=shikimate 3-phosphate}}
+
−
{{#set: molecular weight=251.109    }}
+
−
{{#set: common name=shikimate 5-phosphate|shikimate-5-P|3-phosphoshikimate|shikimate-3-P}}
+
−
{{#set: consumed or produced by=2.5.1.19-RXN|SHIKIMATE-KINASE-RXN}}
+

Latest revision as of 19:11, 21 March 2018

Pathway PWY-7204

  • taxonomic range:
  • common name:
    • pyridoxal 5'-phosphate salvage II (plants)
  • Synonym(s):
    • vitamin B6 salvage (plants)

Reaction(s) found

8 reactions found over 9 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-7204&oldid=39982"