Difference between revisions of "RXN-12876"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5P SHIKIMATE-5P] == * smiles: ** C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1) * com...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12876 RXN-12876] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12876 RXN-12876] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | == | + | * With identifiers: |
| − | == | + | ** 2 [[Cytochromes-C-Oxidized]][c] '''+''' 1 [[ASCORBATE]][c] '''=>''' 1 [[L-DEHYDRO-ASCORBATE]][c] '''+''' 1 [[PROTON]][c] '''+''' 2 [[Cytochromes-C-Reduced]][c] |
| − | * [[ | + | * With common name(s): |
| − | * [[ | + | ** 2 an oxidized c-type cytochrome[c] '''+''' 1 L-ascorbate[c] '''=>''' 1 L-dehydro-ascorbate[c] '''+''' 1 H+[c] '''+''' 2 a reduced c-type cytochrome[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | * LIGAND-RXN: | |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?R07679 R07679] | |
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | * LIGAND- | + | {{#set: reconstruction source=annotation-in-silico_annotation}} |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: reconstruction tool=pathwaytools}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
Latest revision as of 19:11, 21 March 2018
Contents
Reaction RXN-12876
- direction:
- LEFT-TO-RIGHT
- Synonym(s):
Reaction Formula
- With identifiers:
- 2 Cytochromes-C-Oxidized[c] + 1 ASCORBATE[c] => 1 L-DEHYDRO-ASCORBATE[c] + 1 PROTON[c] + 2 Cytochromes-C-Reduced[c]
- With common name(s):
- 2 an oxidized c-type cytochrome[c] + 1 L-ascorbate[c] => 1 L-dehydro-ascorbate[c] + 1 H+[c] + 2 a reduced c-type cytochrome[c]
Genes associated with this reaction
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
- LIGAND-RXN:
