Difference between revisions of "SHIKIMATE-5P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12400 RXN-12400] == * direction: ** LEFT-TO-RIGHT * common name: ** xyloglucan XLLG oligosaccha...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5P SHIKIMATE-5P] == * smiles: ** C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1) * com...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12400 RXN-12400] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5P SHIKIMATE-5P] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1)
 
* common name:
 
* common name:
−
** xyloglucan XLLG oligosaccharide β-galactosidase
+
** shikimate 3-phosphate
−
** glycoside_hydrolase
+
* inchi key:
−
** polyprotein
+
** InChIKey=QYOJSKGCWNAKGW-PBXRRBTRSA-K
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/3.2.1.23 EC-3.2.1.23]
+
** 251.109   
 
* Synonym(s):
 
* Synonym(s):
 +
** shikimate 5-phosphate
 +
** shikimate-5-P
 +
** 3-phosphoshikimate
 +
** shikimate-3-P
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[CPD-13378]][c] '''+''' 2 [[WATER]][c] '''=>''' 2 [[D-galactopyranose]][c] '''+''' 1 [[CPD-13375]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[2.5.1.19-RXN]]
−
** 1 XLLG xyloglucan oligosaccharide[c] '''+''' 2 H2O[c] '''=>''' 2 D-galactopyranose[c] '''+''' 1 XXXG xyloglucan oligosaccharide[c]
+
* [[SHIKIMATE-KINASE-RXN]]
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_12839]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
* [[Tiso_gene_1398]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_17558]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-6807]], xyloglucan degradation II (exoglucanase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6807 PWY-6807]
+
−
** '''3''' reactions found over '''6''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=xyloglucan XLLG oligosaccharide β-galactosidase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14506806 14506806]
−
{{#set: common name=glycoside_hydrolase}}
+
* CHEBI:
−
{{#set: common name=polyprotein}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=145989 145989]
−
{{#set: ec number=EC-3.2.1.23}}
+
* BIGG : skm5p
−
{{#set: gene associated=Tiso_gene_12839|Tiso_gene_1398|Tiso_gene_17558}}
+
* LIGAND-CPD:
−
{{#set: in pathway=PWY-6807}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C03175 C03175]
−
{{#set: reconstruction category=orthology}}
+
{{#set: smiles=C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1)}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: common name=shikimate 3-phosphate}}
−
{{#set: reconstruction source=esiliculosus}}
+
{{#set: inchi key=InChIKey=QYOJSKGCWNAKGW-PBXRRBTRSA-K}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: molecular weight=251.109    }}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=shikimate 5-phosphate|shikimate-5-P|3-phosphoshikimate|shikimate-3-P}}
−
{{#set: reconstruction source=in-silico_annotation}}
+
{{#set: reversible reaction associated=2.5.1.19-RXN|SHIKIMATE-KINASE-RXN}}

Latest revision as of 19:11, 21 March 2018

Metabolite SHIKIMATE-5P

  • smiles:
    • C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1)
  • common name:
    • shikimate 3-phosphate
  • inchi key:
    • InChIKey=QYOJSKGCWNAKGW-PBXRRBTRSA-K
  • molecular weight:
    • 251.109
  • Synonym(s):
    • shikimate 5-phosphate
    • shikimate-5-P
    • 3-phosphoshikimate
    • shikimate-3-P

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=SHIKIMATE-5P&oldid=39988"