Difference between revisions of "PWY-7297"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLUCURONOLACTONE D-GLUCURONOLACTONE] == * smiles: ** C1(=O)(C(O)C(O)[CH](C(O)C=O)O1) * inchi...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7297 PWY-7297] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33317 TAX-3...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7297 PWY-7297] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33317 TAX-33317] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-7735 TAX-7735] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-6157 TAX-6157] |
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-7586 TAX-7586] | ||
* common name: | * common name: | ||
− | ** | + | ** octopamine biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''1''' reactions found over '''2''' reactions in the full pathway | |
− | == Reaction(s) | + | * [[TYROSINE-DECARBOXYLASE-RXN]] |
− | * [ | + | ** 1 associated gene(s): |
+ | *** [[Tiso_gene_3686]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14645 RXN-14645] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-33317}} | |
− | + | {{#set: taxonomic range=TAX-7735}} | |
− | + | {{#set: taxonomic range=TAX-6157}} | |
− | + | {{#set: taxonomic range=TAX-7586}} | |
− | + | {{#set: common name=octopamine biosynthesis}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=2}} | |
− | + | {{#set: completion rate=50.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:11, 21 March 2018
Pathway PWY-7297
- taxonomic range:
- common name:
- octopamine biosynthesis
- Synonym(s):
Reaction(s) found
1 reactions found over 2 reactions in the full pathway
- TYROSINE-DECARBOXYLASE-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated: