Difference between revisions of "Tiso gene 13243"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLUCURONOLACTONE D-GLUCURONOLACTONE] == * smiles: ** C1(=O)(C(O)C(O)[CH](C(O)C=O)O1) * common...") |
(Created page with "Category:Gene == Gene Tiso_gene_13243 == * Synonym(s): == Reactions associated == * Reaction: UBIQUITIN--PROTEIN-LIGASE-RXN ** Source: orthology-esiliculosus == P...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_13243 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reactions associated == |
| − | + | * Reaction: [[UBIQUITIN--PROTEIN-LIGASE-RXN]] | |
| − | == | + | ** Source: [[orthology-esiliculosus]] |
| − | * [[ | + | == Pathways associated == |
| + | * [[PWY-7511]] | ||
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=UBIQUITIN--PROTEIN-LIGASE-RXN}} | |
| − | + | {{#set: pathway associated=PWY-7511}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Latest revision as of 19:11, 21 March 2018
Gene Tiso_gene_13243
- Synonym(s):
Reactions associated
- Reaction: UBIQUITIN--PROTEIN-LIGASE-RXN
- Source: orthology-esiliculosus
