Difference between revisions of "PWY-5139"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4125 CPD-4125] == * smiles: ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5139 PWY-5139] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-33...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4125 CPD-4125] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5139 PWY-5139] ==
* smiles:
+
* taxonomic range:
** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-3398]
* inchi key:
+
** InChIKey=MCWVPSBQQXUCTB-OQTIOYDCSA-N
+
 
* common name:
 
* common name:
** avenasterol
+
** pelargonidin conjugates biosynthesis
* molecular weight:
+
** 412.698   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-4209]]
+
'''1''' reactions found over '''6''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[RXN-7828]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_3452]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7830 RXN-7830]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7832 RXN-7832]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7834 RXN-7834]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7997 RXN-7997]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7998 RXN-7998]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-3398}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12795736 12795736]
+
{{#set: common name=pelargonidin conjugates biosynthesis}}
* LIGAND-CPD:
+
{{#set: reaction found=1}}
** [http://www.genome.jp/dbget-bin/www_bget?C15782 C15782]
+
{{#set: total reaction=6}}
* HMDB : HMDB06851
+
{{#set: completion rate=17.0}}
{{#set: smiles=CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: inchi key=InChIKey=MCWVPSBQQXUCTB-OQTIOYDCSA-N}}
+
{{#set: common name=avenasterol}}
+
{{#set: molecular weight=412.698    }}
+
{{#set: consumed by=RXN-4209}}
+

Latest revision as of 19:11, 21 March 2018

Pathway PWY-5139

  • taxonomic range:
  • common name:
    • pelargonidin conjugates biosynthesis
  • Synonym(s):

Reaction(s) found

1 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links