Difference between revisions of "GLC-6-P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5664 PWY-5664] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-3...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] == * smiles: ** C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O * common name: ** &bet...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5664 PWY-5664] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
+
** C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O
 
* common name:
 
* common name:
−
** tetrahydrobiopterin biosynthesis II
+
** β-D-glucose 6-phosphate
 +
* inchi key:
 +
** InChIKey=NBSCHQHZLSJFNQ-VFUOTHLCSA-L
 +
* molecular weight:
 +
** 258.121   
 
* Synonym(s):
 
* Synonym(s):
 +
** β-D-glucose-6-P
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''1''' reactions found over '''4''' reactions in the full pathway
+
* [[G6PBDHh]]
−
* [[GTP-CYCLOHYDRO-I-RXN]]
+
* [[RXN66-579]]
−
** 1 associated gene(s):
+
== Reaction(s) known to produce the compound ==
−
*** [[Tiso_gene_12736]]
+
== Reaction(s) of unknown directionality ==
−
** 3 reconstruction source(s) associated:
+
* [[PGIB]]
−
*** [[orthology-creinhardtii]]
+
* [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]]
−
*** [[orthology-synechocystis]]
+
* [[G6PI]]
−
*** [[orthology-esiliculosus]]
+
* [[G6PB_pi_th]]
−
== Reaction(s) not found ==
+
* [[PGIBh]]
−
* [http://metacyc.org/META/NEW-IMAGE?object=1.1.1.220-RXN 1.1.1.220-RXN]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=4.2.3.12-RXN 4.2.3.12-RXN]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8854 RXN-8854]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-33208}}
+
* PUBCHEM:
−
{{#set: common name=tetrahydrobiopterin biosynthesis II}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21604865 21604865]
−
{{#set: reaction found=1}}
+
* HMDB : HMDB03498
−
{{#set: total reaction=4}}
+
* LIGAND-CPD:
−
{{#set: completion rate=25.0}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01172 C01172]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.10239176.html 10239176]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58247 58247]
 +
* BIGG : g6p
 +
{{#set: smiles=C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O}}
 +
{{#set: common name=β-D-glucose 6-phosphate}}
 +
{{#set: inchi key=InChIKey=NBSCHQHZLSJFNQ-VFUOTHLCSA-L}}
 +
{{#set: molecular weight=258.121    }}
 +
{{#set: common name=β-D-glucose-6-P}}
 +
{{#set: consumed by=G6PBDHh|RXN66-579}}
 +
{{#set: reversible reaction associated=PGIB|GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN|G6PI|G6PB_pi_th|PGIBh}}

Latest revision as of 19:11, 21 March 2018

Metabolite GLC-6-P

  • smiles:
    • C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O
  • common name:
    • β-D-glucose 6-phosphate
  • inchi key:
    • InChIKey=NBSCHQHZLSJFNQ-VFUOTHLCSA-L
  • molecular weight:
    • 258.121
  • Synonym(s):
    • β-D-glucose-6-P

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=GLC-6-P&oldid=40024"