Difference between revisions of "GLC-6-P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_5483 == * right end position: ** 13241 * transcription direction: ** POSITIVE * left end position: ** 8781 * centisome position: ** 65.7260...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] == * smiles: ** C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O * common name: ** &bet...")
 
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_5483 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] ==
−
* right end position:
+
* smiles:
−
** 13241
+
** C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O
−
* transcription direction:
+
* common name:
−
** POSITIVE
+
** β-D-glucose 6-phosphate
−
* left end position:
+
* inchi key:
−
** 8781
+
** InChIKey=NBSCHQHZLSJFNQ-VFUOTHLCSA-L
−
* centisome position:
+
* molecular weight:
−
** 65.72605    
+
** 258.121    
 
* Synonym(s):
 
* Synonym(s):
 +
** β-D-glucose-6-P
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* Reaction: [[ADENYLATECYC-RXN]]
+
* [[G6PBDHh]]
−
** Source: [[annotation-in-silico_annotation]]
+
* [[RXN66-579]]
−
*** Assignment: automated-name-match
+
== Reaction(s) known to produce the compound ==
−
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
 +
* [[PGIB]]
 +
* [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]]
 +
* [[G6PI]]
 +
* [[G6PB_pi_th]]
 +
* [[PGIBh]]
 
== External links  ==
 
== External links  ==
−
{{#set: right end position=13241}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21604865 21604865]
−
{{#set: left end position=8781}}
+
* HMDB : HMDB03498
−
{{#set: centisome position=65.72605   }}
+
* LIGAND-CPD:
−
{{#set: reaction associated=ADENYLATECYC-RXN}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01172 C01172]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.10239176.html 10239176]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58247 58247]
 +
* BIGG : g6p
 +
{{#set: smiles=C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O}}
 +
{{#set: common name=β-D-glucose 6-phosphate}}
 +
{{#set: inchi key=InChIKey=NBSCHQHZLSJFNQ-VFUOTHLCSA-L}}
 +
{{#set: molecular weight=258.121   }}
 +
{{#set: common name=β-D-glucose-6-P}}
 +
{{#set: consumed by=G6PBDHh|RXN66-579}}
 +
{{#set: reversible reaction associated=PGIB|GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN|G6PI|G6PB_pi_th|PGIBh}}

Latest revision as of 19:11, 21 March 2018

Metabolite GLC-6-P

  • smiles:
    • C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O
  • common name:
    • β-D-glucose 6-phosphate
  • inchi key:
    • InChIKey=NBSCHQHZLSJFNQ-VFUOTHLCSA-L
  • molecular weight:
    • 258.121
  • Synonym(s):
    • β-D-glucose-6-P

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=GLC-6-P&oldid=40024"