Difference between revisions of "Tiso gene 15422"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] == * smiles: ** C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O * inchi key: ** InChIK...")
(Created page with "Category:Gene == Gene Tiso_gene_15422 == * right end position: ** 4726 * transcription direction: ** POSITIVE * left end position: ** 3274 * centisome position: ** 65.1153...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] ==
+
== Gene Tiso_gene_15422 ==
−
* smiles:
+
* right end position:
−
** C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O
+
** 4726
−
* inchi key:
+
* transcription direction:
−
** InChIKey=NBSCHQHZLSJFNQ-VFUOTHLCSA-L
+
** POSITIVE
−
* common name:
+
* left end position:
−
** β-D-glucose 6-phosphate
+
** 3274
−
* molecular weight:
+
* centisome position:
−
** 258.121    
+
** 65.11536    
 
* Synonym(s):
 
* Synonym(s):
−
** β-D-glucose-6-P
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[G6PBDHh]]
+
* Reaction: [[3.3.2.8-RXN]]
−
* [[RXN66-579]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) known to produce the compound ==
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-9412]]
−
* [[PGIB]]
+
** Source: [[annotation-in-silico_annotation]]
−
* [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]]
+
*** Assignment: automated-name-match
−
* [[G6PI]]
+
* Reaction: [[RXN-9413]]
−
* [[G6PB_pi_th]]
+
** Source: [[annotation-in-silico_annotation]]
−
* [[PGIBh]]
+
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-9464]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-5923]]
 +
* [[PWY-5924]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=4726}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21604865 21604865]
+
{{#set: transcription direction=POSITIVE}}
−
* HMDB : HMDB03498
+
{{#set: left end position=3274}}
−
* LIGAND-CPD:
+
{{#set: centisome position=65.11536   }}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01172 C01172]
+
{{#set: reaction associated=3.3.2.8-RXN|RXN-9412|RXN-9413|RXN-9464}}
−
* CHEMSPIDER:
+
{{#set: pathway associated=PWY-5923|PWY-5924}}
−
** [http://www.chemspider.com/Chemical-Structure.10239176.html 10239176]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58247 58247]
+
−
* BIGG : g6p
+
−
{{#set: smiles=C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O}}
+
−
{{#set: inchi key=InChIKey=NBSCHQHZLSJFNQ-VFUOTHLCSA-L}}
+
−
{{#set: common name=β-D-glucose 6-phosphate}}
+
−
{{#set: molecular weight=258.121   }}
+
−
{{#set: common name=β-D-glucose-6-P}}
+
−
{{#set: consumed by=G6PBDHh|RXN66-579}}
+
−
{{#set: reversible reaction associated=PGIB|GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN|G6PI|G6PB_pi_th|PGIBh}}
+

Latest revision as of 19:11, 21 March 2018

Gene Tiso_gene_15422

  • right end position:
    • 4726
  • transcription direction:
    • POSITIVE
  • left end position:
    • 3274
  • centisome position:
    • 65.11536
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_15422&oldid=40026"