Difference between revisions of "RXN1F-66"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CINNAMOYL-COA CINNAMOYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(=CC=CC=C1))C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-66 RXN1F-66] == * direction: ** REVERSIBLE * common name: ** chlorophyll_chloroplastic * ec n...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CINNAMOYL-COA CINNAMOYL-COA] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-66 RXN1F-66] ==
* smiles:
+
* direction:
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
** REVERSIBLE
* inchi key:
+
** InChIKey=JVNVHNHITFVWIX-KZKUDURGSA-J
+
 
* common name:
 
* common name:
** (E)-cinnamoyl-CoA
+
** chlorophyll_chloroplastic
* molecular weight:
+
* ec number:
** 893.648   
+
** [http://enzyme.expasy.org/EC/2.5.1.62 EC-2.5.1.62]
 
* Synonym(s):
 
* Synonym(s):
** trans-cinnamoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-2001]]
+
** 1 [[CHLOROPHYLLIDE-A]][c] '''+''' 1 [[PHYTYL-PYROPHOSPHATE]][c] '''+''' 1 [[PROTON]][c] '''<=>''' 1 [[CHLOROPHYLL-A]][c] '''+''' 1 [[PPI]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 chlorophyllide a[c] '''+''' 1 phytyl diphosphate[c] '''+''' 1 H+[c] '''<=>''' 1 chlorophyll a[c] '''+''' 1 diphosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_19542]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
* [[PWY-5068]], chlorophyll cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5068 PWY-5068]
 +
** '''4''' reactions found over '''6''' reactions in the full pathway
 +
* [[PWY-7764]], chlorophyll a biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7764 PWY-7764]
 +
** '''1''' reactions found over '''2''' reactions in the full pathway
 +
* [[PWY-5086]], chlorophyll a biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5086 PWY-5086]
 +
** '''2''' reactions found over '''2''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* RHEA:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229143 44229143]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=17317 17317]
* CHEBI:
+
* LIGAND-RXN:
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57252 57252]
+
** [http://www.genome.jp/dbget-bin/www_bget?R06284 R06284]
* LIGAND-CPD:
+
{{#set: direction=REVERSIBLE}}
** [http://www.genome.jp/dbget-bin/www_bget?C16256 C16256]
+
{{#set: common name=chlorophyll_chloroplastic}}
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
{{#set: ec number=EC-2.5.1.62}}
{{#set: inchi key=InChIKey=JVNVHNHITFVWIX-KZKUDURGSA-J}}
+
{{#set: gene associated=Tiso_gene_19542}}
{{#set: common name=(E)-cinnamoyl-CoA}}
+
{{#set: in pathway=PWY-5068|PWY-7764|PWY-5086}}
{{#set: molecular weight=893.648    }}
+
{{#set: reconstruction category=orthology|annotation}}
{{#set: common name=trans-cinnamoyl-CoA}}
+
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-creinhardtii|orthology-esiliculosus}}
{{#set: produced by=RXN-2001}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}

Latest revision as of 20:11, 21 March 2018

Reaction RXN1F-66

  • direction:
    • REVERSIBLE
  • common name:
    • chlorophyll_chloroplastic
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5068, chlorophyll cycle: PWY-5068
    • 4 reactions found over 6 reactions in the full pathway
  • PWY-7764, chlorophyll a biosynthesis III: PWY-7764
    • 1 reactions found over 2 reactions in the full pathway
  • PWY-5086, chlorophyll a biosynthesis I: PWY-5086
    • 2 reactions found over 2 reactions in the full pathway

Reconstruction information

External links