Difference between revisions of "Tiso gene 7813"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-136 CPD1F-136] == * smiles: ** C=C1(C4(CC[CH]3(C(C1)(C(O)C[CH]2(C(C([O-])=O)(C)CCCC(C)23)...")
 
(Created page with "Category:Gene == Gene Tiso_gene_7813 == * right end position: ** 7136 * transcription direction: ** POSITIVE * left end position: ** 3064 * centisome position: ** 28.41246...")
 
(4 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-136 CPD1F-136] ==
+
== Gene Tiso_gene_7813 ==
−
* smiles:
+
* right end position:
−
** C=C1(C4(CC[CH]3(C(C1)(C(O)C[CH]2(C(C([O-])=O)(C)CCCC(C)23))C4)))
+
** 7136
−
* inchi key:
+
* transcription direction:
−
** InChIKey=KMLXVEXJZSTMBV-YDIYEOSVSA-M
+
** POSITIVE
−
* common name:
+
* left end position:
−
** ent-7α-hydroxykaur-16-en-19-oate
+
** 3064
−
* molecular weight:
+
* centisome position:
−
** 317.447    
+
** 28.412464    
 
* Synonym(s):
 
* Synonym(s):
−
** ent-7-α-hydroxykaurenoate
 
−
** ent-7-α-hydroxykaurenoic acid
 
−
** 7-hydroxy-kaurenoic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN1F-160]]
+
* Reaction: [[PROTEIN-KINASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[1.14.13.79-RXN]]
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMPR0104540005
+
{{#set: right end position=7136}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200352 25200352]
+
{{#set: left end position=3064}}
−
* CHEBI:
+
{{#set: centisome position=28.412464   }}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57298 57298]
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C11875 C11875]
+
−
{{#set: smiles=C=C1(C4(CC[CH]3(C(C1)(C(O)C[CH]2(C(C([O-])=O)(C)CCCC(C)23))C4)))}}
+
−
{{#set: inchi key=InChIKey=KMLXVEXJZSTMBV-YDIYEOSVSA-M}}
+
−
{{#set: common name=ent-7α-hydroxykaur-16-en-19-oate}}
+
−
{{#set: molecular weight=317.447   }}
+
−
{{#set: common name=ent-7-α-hydroxykaurenoate|ent-7-α-hydroxykaurenoic acid|7-hydroxy-kaurenoic acid}}
+
−
{{#set: consumed by=RXN1F-160}}
+
−
{{#set: produced by=1.14.13.79-RXN}}
+

Latest revision as of 19:11, 21 March 2018

Gene Tiso_gene_7813

  • right end position:
    • 7136
  • transcription direction:
    • POSITIVE
  • left end position:
    • 3064
  • centisome position:
    • 28.412464
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_7813&oldid=40057"