Difference between revisions of "P21-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASN ASN] == * smiles: ** C(CC(C(=O)[O-])[N+])(N)=O * inchi key: ** InChIKey=DCXYFEDJOCDNAF-REOH...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=P21-PWY P21-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2093 TAX-2093...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=P21-PWY P21-PWY] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2093 TAX-2093] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** pentose phosphate pathway (partial) |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** pentose phosphate pathway, Mycoplasma pneumonia |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''3''' reactions found over '''3''' reactions in the full pathway |
| − | * [[ | + | * [[1TRANSKETO-RXN]] |
| − | * [[ | + | ** 2 associated gene(s): |
| − | + | *** [[Tiso_gene_11559]] | |
| − | * [[ | + | *** [[Tiso_gene_5008]] |
| − | * [[ | + | ** 5 reconstruction source(s) associated: |
| − | * [[ | + | *** [[annotation-in-silico_annotation]] |
| − | == Reaction(s) | + | *** [[orthology-athaliana]] |
| + | *** [[annotation-experimental_annotation]] | ||
| + | *** [[orthology-synechocystis]] | ||
| + | *** [[manual-primary_network]] | ||
| + | * [[2TRANSKETO-RXN]] | ||
| + | ** 2 associated gene(s): | ||
| + | *** [[Tiso_gene_11559]] | ||
| + | *** [[Tiso_gene_5008]] | ||
| + | ** 5 reconstruction source(s) associated: | ||
| + | *** [[annotation-experimental_annotation]] | ||
| + | *** [[orthology-athaliana]] | ||
| + | *** [[orthology-creinhardtii]] | ||
| + | *** [[manual-primary_network]] | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | * [[RIBULP3EPIM-RXN]] | ||
| + | ** 3 associated gene(s): | ||
| + | *** [[Tiso_gene_19140]] | ||
| + | *** [[Tiso_gene_4754]] | ||
| + | *** [[Tiso_gene_10879]] | ||
| + | ** 7 reconstruction source(s) associated: | ||
| + | *** [[annotation-experimental_annotation]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[orthology-athaliana]] | ||
| + | *** [[orthology-synechocystis]] | ||
| + | *** [[manual-primary_network]] | ||
| + | *** [[orthology-creinhardtii]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2093}} | |
| − | + | {{#set: common name=pentose phosphate pathway (partial)}} | |
| − | + | {{#set: common name=pentose phosphate pathway, Mycoplasma pneumonia}} | |
| − | + | {{#set: reaction found=3}} | |
| − | + | {{#set: total reaction=3}} | |
| − | + | {{#set: completion rate=100.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 19:11, 21 March 2018
Pathway P21-PWY
- taxonomic range:
- common name:
- pentose phosphate pathway (partial)
- Synonym(s):
- pentose phosphate pathway, Mycoplasma pneumonia
Reaction(s) found
3 reactions found over 3 reactions in the full pathway
- 1TRANSKETO-RXN
- 2 associated gene(s):
- 5 reconstruction source(s) associated:
- 2TRANSKETO-RXN
- 2 associated gene(s):
- 5 reconstruction source(s) associated:
- RIBULP3EPIM-RXN
- 3 associated gene(s):
- 7 reconstruction source(s) associated:
