Difference between revisions of "CPD-4573"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5278 PWY-5278] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4573 CPD-4573] == * smiles: ** CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5278 PWY-5278] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4573 CPD-4573] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
 
* common name:
 
* common name:
−
** sulfite oxidation III
+
** 14-oxolanosterol
 +
* inchi key:
 +
** InChIKey=PGGIMLIQOHYFIS-PUXRVUTHSA-N
 +
* molecular weight:
 +
** 440.708   
 
* Synonym(s):
 
* Synonym(s):
 +
** 14-oxo-lanosterol
 +
** 4,4-dimethyl-14α-formyl-5α-cholesta-8,24-dien-3β-ol
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''1''' reactions found over '''2''' reactions in the full pathway
+
* [[RXN66-305]]
−
* [[SULFATE-ADENYLYLTRANS-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** 2 associated gene(s):
+
* [[RXN66-304]]
−
*** [[Tiso_gene_10254]]
+
== Reaction(s) of unknown directionality ==
−
*** [[Tiso_gene_17879]]
+
−
** 5 reconstruction source(s) associated:
+
−
*** [[orthology-athaliana]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-synechocystis]]
+
−
*** [[orthology-esiliculosus]]
+
−
*** [[manual-primary_network]]
+
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=ADENYLYLSULFATE-REDUCTASE-RXN ADENYLYLSULFATE-REDUCTASE-RXN]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-2}}
+
* PUBCHEM:
−
{{#set: common name=sulfite oxidation III}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21121725 21121725]
−
{{#set: reaction found=1}}
+
{{#set: smiles=CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C}}
−
{{#set: total reaction=2}}
+
{{#set: common name=14-oxolanosterol}}
−
{{#set: completion rate=50.0}}
+
{{#set: inchi key=InChIKey=PGGIMLIQOHYFIS-PUXRVUTHSA-N}}
 +
{{#set: molecular weight=440.708    }}
 +
{{#set: common name=14-oxo-lanosterol|4,4-dimethyl-14α-formyl-5α-cholesta-8,24-dien-3β-ol}}
 +
{{#set: consumed by=RXN66-305}}
 +
{{#set: produced by=RXN66-304}}

Latest revision as of 19:11, 21 March 2018

Metabolite CPD-4573

  • smiles:
    • CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
  • common name:
    • 14-oxolanosterol
  • inchi key:
    • InChIKey=PGGIMLIQOHYFIS-PUXRVUTHSA-N
  • molecular weight:
    • 440.708
  • Synonym(s):
    • 14-oxo-lanosterol
    • 4,4-dimethyl-14α-formyl-5α-cholesta-8,24-dien-3β-ol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-4573&oldid=40091"