Difference between revisions of "CPD-4573"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_1584 == * left end position: ** 4123 * transcription direction: ** POSITIVE * right end position: ** 4613 * centisome position: ** 17.89341...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4573 CPD-4573] == * smiles: ** CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C...") |
||
(4 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4573 CPD-4573] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C |
− | * | + | * common name: |
− | ** | + | ** 14-oxolanosterol |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=PGGIMLIQOHYFIS-PUXRVUTHSA-N |
− | * | + | * molecular weight: |
− | ** | + | ** 440.708 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 14-oxo-lanosterol | ||
+ | ** 4,4-dimethyl-14α-formyl-5α-cholesta-8,24-dien-3β-ol | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN66-305]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN66-304]] | |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21121725 21121725] |
− | {{#set: | + | {{#set: smiles=CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C}} |
− | {{#set: | + | {{#set: common name=14-oxolanosterol}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=PGGIMLIQOHYFIS-PUXRVUTHSA-N}} |
− | {{#set: | + | {{#set: molecular weight=440.708 }} |
+ | {{#set: common name=14-oxo-lanosterol|4,4-dimethyl-14α-formyl-5α-cholesta-8,24-dien-3β-ol}} | ||
+ | {{#set: consumed by=RXN66-305}} | ||
+ | {{#set: produced by=RXN66-304}} |
Latest revision as of 19:11, 21 March 2018
Contents
Metabolite CPD-4573
- smiles:
- CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
- common name:
- 14-oxolanosterol
- inchi key:
- InChIKey=PGGIMLIQOHYFIS-PUXRVUTHSA-N
- molecular weight:
- 440.708
- Synonym(s):
- 14-oxo-lanosterol
- 4,4-dimethyl-14α-formyl-5α-cholesta-8,24-dien-3β-ol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C" cannot be used as a page name in this wiki.