Difference between revisions of "CPD-4573"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_1584 == * left end position: ** 4123 * transcription direction: ** POSITIVE * right end position: ** 4613 * centisome position: ** 17.89341...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4573 CPD-4573] == * smiles: ** CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C...")
 
(4 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_1584 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4573 CPD-4573] ==
−
* left end position:
+
* smiles:
−
** 4123
+
** CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
−
* transcription direction:
+
* common name:
−
** POSITIVE
+
** 14-oxolanosterol
−
* right end position:
+
* inchi key:
−
** 4613
+
** InChIKey=PGGIMLIQOHYFIS-PUXRVUTHSA-N
−
* centisome position:
+
* molecular weight:
−
** 17.893414    
+
** 440.708    
 
* Synonym(s):
 
* Synonym(s):
 +
** 14-oxo-lanosterol
 +
** 4,4-dimethyl-14α-formyl-5α-cholesta-8,24-dien-3β-ol
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[RXN-15556]]
+
* [[RXN66-305]]
−
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
* [[RXN66-304]]
−
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** in-silico_annotation
+
−
***ec-number
+
−
== Pathways associated ==
+
−
* [[PWY-7511]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=4123}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21121725 21121725]
−
{{#set: right end position=4613}}
+
{{#set: smiles=CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C}}
−
{{#set: centisome position=17.893414   }}
+
{{#set: common name=14-oxolanosterol}}
−
{{#set: reaction associated=RXN-15556|UBIQUITIN--PROTEIN-LIGASE-RXN}}
+
{{#set: inchi key=InChIKey=PGGIMLIQOHYFIS-PUXRVUTHSA-N}}
−
{{#set: pathway associated=PWY-7511}}
+
{{#set: molecular weight=440.708   }}
 +
{{#set: common name=14-oxo-lanosterol|4,4-dimethyl-14α-formyl-5α-cholesta-8,24-dien-3β-ol}}
 +
{{#set: consumed by=RXN66-305}}
 +
{{#set: produced by=RXN66-304}}

Latest revision as of 19:11, 21 March 2018

Metabolite CPD-4573

  • smiles:
    • CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
  • common name:
    • 14-oxolanosterol
  • inchi key:
    • InChIKey=PGGIMLIQOHYFIS-PUXRVUTHSA-N
  • molecular weight:
    • 440.708
  • Synonym(s):
    • 14-oxo-lanosterol
    • 4,4-dimethyl-14α-formyl-5α-cholesta-8,24-dien-3β-ol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-4573&oldid=40091"