Difference between revisions of "PWY-5080"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4573 CPD-4573] == * smiles: ** CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5080 PWY-5080] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4573 CPD-4573] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5080 PWY-5080] ==
−
* smiles:
+
* taxonomic range:
−
** CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
 
* common name:
 
* common name:
−
** 14-oxolanosterol
+
** very long chain fatty acid biosynthesis I
−
* inchi key:
+
−
** InChIKey=PGGIMLIQOHYFIS-PUXRVUTHSA-N
+
−
* molecular weight:
+
−
** 440.708   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 14-oxo-lanosterol
+
** VLCFAs biosynthesis I
−
** 4,4-dimethyl-14α-formyl-5α-cholesta-8,24-dien-3β-ol
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN66-305]]
+
'''4''' reactions found over '''4''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-11750]]
−
* [[RXN66-304]]
+
** 0 associated gene:
−
== Reaction(s) of unknown directionality ==
+
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[RXN-7697]]
 +
** 0 associated gene:
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-7698]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_9871]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-7711]]
 +
** 0 associated gene:
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* ARACYC:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21121725 21121725]
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5080 PWY-5080]
−
{{#set: smiles=CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C}}
+
{{#set: taxonomic range=TAX-2}}
−
{{#set: common name=14-oxolanosterol}}
+
{{#set: taxonomic range=TAX-2759}}
−
{{#set: inchi key=InChIKey=PGGIMLIQOHYFIS-PUXRVUTHSA-N}}
+
{{#set: common name=very long chain fatty acid biosynthesis I}}
−
{{#set: molecular weight=440.708    }}
+
{{#set: common name=VLCFAs biosynthesis I}}
−
{{#set: common name=14-oxo-lanosterol|4,4-dimethyl-14α-formyl-5α-cholesta-8,24-dien-3β-ol}}
+
{{#set: reaction found=4}}
−
{{#set: consumed by=RXN66-305}}
+
{{#set: total reaction=4}}
−
{{#set: produced by=RXN66-304}}
+
{{#set: completion rate=100.0}}

Latest revision as of 20:12, 21 March 2018

Pathway PWY-5080

  • taxonomic range:
  • common name:
    • very long chain fatty acid biosynthesis I
  • Synonym(s):
    • VLCFAs biosynthesis I

Reaction(s) found

4 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-5080&oldid=40096"