Difference between revisions of "FAD"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_5622 == * Synonym(s): == Reactions associated == * RXN-15556 ** in-silico_annotation ***ec-number * UBIQUITIN--PROTEIN-LIGASE-RXN...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FAD FAD] == * smiles: ** CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FAD FAD] == |
+ | * smiles: | ||
+ | ** CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(C(O)C(O)C(N3(C=NC2(C(N)=NC=NC=23)))O4))=O)([O-])=O)O)5))=C6)) | ||
+ | * common name: | ||
+ | ** FAD | ||
+ | * inchi key: | ||
+ | ** InChIKey=IMGVNJNCCGXBHD-UYBVJOGSSA-K | ||
+ | * molecular weight: | ||
+ | ** 782.533 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** flavin adenine dinucleotide oxidized | ||
+ | ** flavin adenine dinucleotide | ||
+ | ** flavitan | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[MEPROPCOA-FAD-RXN]] |
− | ** | + | * [[ACOA120or]] |
− | *** | + | * [[MCDH_2mb2coa]] |
− | * [[ | + | * [[ACOA140or]] |
− | ** | + | * [[ACOA160or]] |
− | ** | + | * [[ACOA80or]] |
− | == | + | * [[MCDH]] |
− | * [[ | + | * [[IVCDH]] |
+ | * [[ACOA40or]] | ||
+ | == Reaction(s) known to produce the compound == | ||
+ | * [[G3PD3]] | ||
+ | * [[FADSYN-RXN]] | ||
+ | == Reaction(s) of unknown directionality == | ||
+ | * [[PPCOAOm]] | ||
+ | * [[RXN-14264]] | ||
+ | * [[RXN-14193]] | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 146-14-5 |
− | {{#set: | + | * Wikipedia : Flavin_adenine_dinucleotide |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46906035 46906035] | ||
+ | * HMDB : HMDB01248 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00016 C00016] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.13082029.html 13082029] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57692 57692] | ||
+ | * BIGG : fad | ||
+ | {{#set: smiles=CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(C(O)C(O)C(N3(C=NC2(C(N)=NC=NC=23)))O4))=O)([O-])=O)O)5))=C6))}} | ||
+ | {{#set: common name=FAD}} | ||
+ | {{#set: inchi key=InChIKey=IMGVNJNCCGXBHD-UYBVJOGSSA-K}} | ||
+ | {{#set: molecular weight=782.533 }} | ||
+ | {{#set: common name=flavin adenine dinucleotide oxidized|flavin adenine dinucleotide|flavitan}} | ||
+ | {{#set: consumed by=MEPROPCOA-FAD-RXN|ACOA120or|MCDH_2mb2coa|ACOA140or|ACOA160or|ACOA80or|MCDH|IVCDH|ACOA40or}} | ||
+ | {{#set: produced by=G3PD3|FADSYN-RXN}} | ||
+ | {{#set: reversible reaction associated=PPCOAOm|RXN-14264|RXN-14193}} |
Latest revision as of 19:12, 21 March 2018
Contents
Metabolite FAD
- smiles:
- CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(C(O)C(O)C(N3(C=NC2(C(N)=NC=NC=23)))O4))=O)([O-])=O)O)5))=C6))
- common name:
- FAD
- inchi key:
- InChIKey=IMGVNJNCCGXBHD-UYBVJOGSSA-K
- molecular weight:
- 782.533
- Synonym(s):
- flavin adenine dinucleotide oxidized
- flavin adenine dinucleotide
- flavitan
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 146-14-5
- Wikipedia : Flavin_adenine_dinucleotide
- PUBCHEM:
- HMDB : HMDB01248
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : fad
"CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(C(O)C(O)C(N3(C=NC2(C(N)=NC=NC=23)))O4))=O)([O-])=O)O)5))=C6))" cannot be used as a page name in this wiki.